((13)C5,(15)N)-valine
AlkaPlorer ID: AK000094
Synonym: 'Val', 'DL-valine', 'L-Val', '2-Amino-3-methylbutyric acid', 'VALINE', 'L-Valin', 'L-(+)-alpha-Aminoisovaleric acid', 'L-alpha-Amino-beta-methylbutyric acid', 'Valin', 'V', '(2S)-2-amino-3-methylbutanoic acid', 'L-valine', '(S)-valine', '640-68-6', 'D-Valine', '72-18-4', 'valine', 'd-valine', 'Hval', '2-amino-3-methylbutanoic acid', 'L-Valine', 'valina'
IUPAC Name: (2R)-2-amino-3-methylbutanoic acid
Structure
SMILES: CC(C)[C@@H](N)C(=O)O
InChI: InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m1/s1
InChIKey: KZSNJWFQEVHDMF-SCSAIBSYSA-N
Source
Properties Information
Molecule Weight: 117.14799999999998
TPSA?: 63.32000000000001
MolLogP?: 0.0543
Number of H-Donors: 2
Number of H-Acceptors: 2
RingCount: 0
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | Histone deacetylase 6 | Inhibition | -33.4 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 1.7 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | L-type amino acid transporter 1 | Activity | 41.0 | % | 10.1021/acs.jmedchem.8b01007 |
| Homo sapiens | L-type amino acid transporter 1 | IC50 | 50000000.0 | nM | 10.1021/acs.jmedchem.8b01007 |
| Homo sapiens | L-type amino acid transporter 1 | Inhibition | 11.0 | % | 10.1021/acs.jmedchem.8b01007 |
| Homo sapiens | Prelamin-A/C | Potency | 19952.6 | nM | None |
| Homo sapiens | Proton-coupled amino acid transporter 1 | Ki | 100000000.0 | nM | 10.1016/j.bmc.2011.08.058 |
| Homo sapiens | Proton-coupled amino acid transporter 1 | pKi | -2.0 | mM | 10.1016/j.bmc.2011.08.058 |
| Homo sapiens | Runt-related transcription factor 1/Core-binding factor subunit beta | Potency | 2511.9 | nM | None |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 16.0 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 19952.62 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 20000.0 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | -0.09 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.22 | % | 10.21203/rs.3.rs-23951/v1 |
