Imperialine
AlkaPlorer ID: AK000314
Synonym: None
IUPAC Name: None
Structure
SMILES: C[C@H]1CC[C@@H]2[NH+](C1)C[C@H]1[C@@H]3C[C@H]4[C@@H](CC(=O)[C@H]5C[C@@H](O)CC[C@@]54C)[C@@H]3CC[C@H]1[C@]2(C)O
InChI: InChI=1S/C27H43NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-23,25,29,31H,4-14H2,1-3H3/p+1/t15-,16-,17+,18+,19-,20-,21+,22-,23+,25-,26+,27-/m0/s1
InChIKey: IQDIERHFZVCNRZ-LRCDAWNTSA-O
Reference
Tortifoline, a novel (20S, 22R)-5.ALPHA.-cevanine alkaloid from Fritillaria tortifolia.
LOTUS: LTS0029514
SuperNatural Ⅲ: SN0152290-18
NPASS: NPC220111
Source
Properties Information
Molecule Weight: 430.65300000000025
TPSA?: 61.97
MolLogP?: 2.4692000000000003
Number of H-Donors: 3
Number of H-Acceptors: 3
RingCount: 6
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Electrophorus electricus | Acetylcholinesterase | IC50 | 100000.0 | nM | 10.1016/j.ejmech.2017.06.007 |
| Electrophorus electricus | Acetylcholinesterase | Inhibition | 24.89 | % | 10.1016/j.bmc.2012.09.040 |
| Equus caballus | Cholinesterase | IC50 | 100000.0 | nM | 10.1016/j.ejmech.2017.06.007 |
| Equus caballus | Cholinesterase | Inhibition | 6.5 | % | 10.1016/j.bmc.2012.09.040 |
| Rattus norvegicus | Trachea | Activity | 0.48 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 0.49 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 0.5 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 0.52 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 0.55 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 0.58 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 2.41 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 2.42 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 2.43 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 2.44 | g | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 5.7 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 6.0 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 6.3 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 6.4 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 6.8 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 7.2 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 14.5 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 28.1 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 35.3 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 40.4 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 45.7 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Activity | 50.7 | % | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | EC50 | 4400.0 | nM | 10.1016/j.bmcl.2016.03.001 |
| Rattus norvegicus | Trachea | Kd | 3.89 | nM | 10.1016/j.bmcl.2016.03.001 |
| None | Unchecked | Potency | 35481.3 | nM | None |
