Pristinamycin 1A
AlkaPlorer ID: AK000393
Synonym: None
IUPAC Name: N-[(3S,6S,12R,15S,16R,19S,22S)-3-[[4-(dimethylamino)phenyl]methyl]-12-ethyl-4,16-dimethyl-2,5,11,14,18,21,24-heptaoxo-19-phenyl-17-oxa-1,4,10,13,20-pentazatricyclo[20.4.0.06,10]hexacosan-15-yl]-3-hydroxypyridine-2-carboxamide
Structure
SMILES: CC[C@H]1N=C(O)[C@@H](N=C(O)C2=C(O)C=CC=N2)[C@@H](C)OC(=O)[C@H](C2=CC=CC=C2)N=C(O)[C@@H]2CC(=O)CCN2C(=O)[C@H](CC2=CC=C(N(C)C)C=C2)N(C)C(=O)[C@@H]2CCCN2C1=O
InChI: InChI=1S/C45H54N8O10/c1-6-31-42(59)52-22-11-14-32(52)43(60)51(5)34(24-27-16-18-29(19-17-27)50(3)4)44(61)53-23-20-30(54)25-33(53)39(56)49-37(28-12-8-7-9-13-28)45(62)63-26(2)36(40(57)47-31)48-41(58)38-35(55)15-10-21-46-38/h7-10,12-13,15-19,21,26,31-34,36-37,55H,6,11,14,20,22-25H2,1-5H3,(H,47,57)(H,48,58)(H,49,56)/t26-,31-,32+,33+,34+,36+,37+/m1/s1
InChIKey: YGXCETJZBDTKRY-DZCVGBHJSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Streptomyces pristinaespiralis | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 866.9729999999996
TPSA?: 238.43000000000004
MolLogP?: 3.525400000000003
Number of H-Donors: 4
Number of H-Acceptors: 12
RingCount: 6
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Escherichia coli | Escherichia coli | Antibiotic resistance | nan | None | 10.1016/s0960-894x(98)00536-8 |
| Escherichia coli | Escherichia coli | MIC | 4.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| Escherichia coli | Escherichia coli | MIC | 64.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| Homo sapiens | P-glycoprotein 1 | Activity | nan | None | 10.1016/0922-4106(95)90193-0 |
| Homo sapiens | P-glycoprotein 1 | Inhibition | 55.0 | % | 10.1016/0922-4106(95)90193-0 |
| Staphylococcus aureus | Staphylococcus aureus | Antibiotic resistance | nan | None | 10.1016/s0960-894x(98)00536-8 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (acute) | 0.0 | % | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (animal toxicity known) | nan | None | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (benign tumour) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (granulomatous hepatitis) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (mechanism) | nan | None | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (moderate) | 0.0 | % | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (moderate) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | Hepatotoxicity (time to onset) | nan | None | 10.1016/s0399-8320(04)95062-2 |
| None | NON-PROTEIN TARGET | MIC | 1.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| None | NON-PROTEIN TARGET | MIC | 2.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| None | NON-PROTEIN TARGET | MIC | 4.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| None | NON-PROTEIN TARGET | MIC | 8.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| None | NON-PROTEIN TARGET | MIC | 32.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| None | NON-PROTEIN TARGET | MIC | 128.0 | ug.mL-1 | 10.1128/aac.01052-07 |
| None | Unchecked | Hepatotoxicity (acute) | 1.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (association with vascular disease) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (choleostasis) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (chronic liver disease) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (cirrhosis) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (comment) | nan | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (cytolytic) | 1.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (malignant tumour) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (severe hepatitis) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (steatosis) | 0.0 | None | 10.1016/s0399-8320(04)95062-2 |
| None | Unchecked | Hepatotoxicity (successful reintroduction) | nan | None | 10.1016/s0399-8320(04)95062-2 |
