tyrokeradine G
AlkaPlorer ID: AK000774
Synonym: None
IUPAC Name: 3-[[(2E)-3-[4-(3-aminopropoxy)-3,5-dibromophenyl]-2-hydroxyiminopropanoyl]amino]propanoic acid
Structure
SMILES: C1=C(C=C(C(=C1Br)OCCCN)Br)C/C(=N\O)/C(=O)NCCC(=O)O
InChI: InChI=1S/C15H19Br2N3O5/c16-10-6-9(7-11(17)14(10)25-5-1-3-18)8-12(20-24)15(23)19-4-2-13(21)22/h6-7,24H,1-5,8,18H2,(H,19,23)(H,21,22)/b20-12+
InChIKey: JMAIXZHVVFRFIT-UDWIEESQSA-N
Reference
Tyrokeradines G and H, new bromotyrosine alkaloids from an Okinawan Verongid sponge
PubChem CID: 122196419
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | None | None | Verongiida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 481.1410000000002
TPSA？: 134.23999999999998
MolLogP？: 1.9028000000000003
Number of H-Donors: 4
Number of H-Acceptors: 6
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus niger | Aspergillus niger | IC50 | 32.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |
| Bacillus subtilis | Bacillus subtilis | MIC | 32.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |
| Candida albicans | Candida albicans | IC50 | 32.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |
| Cryptococcus neoformans | Cryptococcus neoformans | IC50 | 16.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |
| Escherichia coli | Escherichia coli | MIC | 32.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |
| Micrococcus luteus | Micrococcus luteus | MIC | 32.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 32.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | IC50 | 32.0 | ug.mL-1 | 10.1016/j.bmcl.2015.09.061 |