D-leucinium
AlkaPlorer ID: AK001090
Synonym: '', 'L-leucinate', '(RS)-Leucine', 'D-Leucine', '(1R)-1-carboxy-3-methylbutan-1-aminium', 'LEUCINE,(L)', '(2R)-2-amino-4-methylpentanoic acid', 'L-Leuzin', 'D-leucine anion', '.alpha.-Aminoisocaproic acid', 'D-leucinate', '(S)-(+)-leucine', 'L-Leucine', 'leucine', 'L-Leucin', 'L(+)-Leucine', '(1S)-1-carboxy-3-methylbutan-1-aminium', 'D-2-Amino-4-methylvaleric acid', '(S)-(+)-Leucine', 'D-leucine cation', 'D-LEUCINE', 'Leucin', '(2S)-alpha-2-Amino-4-methylvaleric acid', 'DLE', 'L-leucine cation', '(2S)-2-amino-4-methylpentanoate', 'L-Leu', 'Norvaline, 4-methyl-', 'L-leucine', 'D-Leucin', 'L', '(2R)-2-amino-4-methylpentanoate', '(R)-leucine', 'Pentanoic acid, 2-amino-4-methyl-', '(2S)-2-amino-4-methylpentanoic acid', 'Leuzin', '(+-)-Leucine', '2-Amino-4-methylvaleric acid', 'Valeric acid, 2-amino-4-methyl-', 'L-leucine anion', '(2S)-alpha-Leucine', 'D-leucine', 'DL-Leucine', '2-Amino-4-methylpentanoic acid', '(R)-(-)-leucine', '2-amino-4-methylpentanoic acid', 'D-Leuzin', 'L-leucinium', 'Hleu', '(S)-leucine', 'LEUCINE', 'Leu'
IUPAC Name: (2R)-2-amino-4-methylpentanoic acid
Structure
SMILES: CC(C)C[C@@H](N)C(=O)O
InChI: InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1
InChIKey: ROHFNLRQFUQHCH-RXMQYKEDSA-N
Reference
PubChem CID: 133135469
CAS: 328-38-1
LOTUS: LTS0076699
SuperNatural Ⅲ: SN0330814-01
NPASS: NPC317541
Source
Properties Information
Molecule Weight: 131.175
TPSA?: 63.32000000000001
MolLogP?: 0.4443999999999999
Number of H-Donors: 2
Number of H-Acceptors: 2
RingCount: 0
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | L-type amino acid transporter 1 | Activity | 100.0 | % | 10.1021/acs.jmedchem.8b01007 |
| Homo sapiens | L-type amino acid transporter 1 | IC50 | 220000.0 | nM | 10.1021/acs.jmedchem.8b01007 |
| Homo sapiens | L-type amino acid transporter 1 | Inhibition | 56.0 | % | 10.1021/acs.jmedchem.8b01007 |
| Homo sapiens | Prelamin-A/C | Potency | 501.2 | nM | None |
| Homo sapiens | Regulator of G-protein signaling 4 | Potency | 37685.8 | nM | None |
| Plasmodium falciparum | Plasmodium falciparum | Potency | 10691.0 | nM | None |
| Rattus norvegicus | Inositol monophosphatase 1 | Potency | 5011.9 | nM | None |
| Rattus norvegicus | Monocarboxylate transporter 10 | Activity | nan | None | 10.1074/jbc.m009462200 |
| None | Unchecked | Ac50 | 0.3981 | uM | None |
| None | Unchecked | Ac50 | 0.7943 | uM | None |
| None | Unchecked | Ac50 | 0.8913 | uM | None |
| None | Unchecked | AC50 | 398.1 | nM | None |
| None | Unchecked | AC50 | 794.3 | nM | None |
| None | Unchecked | AC50 | 891.3 | nM | None |
