canthin-6-one
AlkaPlorer ID: AK001174
Synonym: '', '6H-Indolo(3,2,1-de)(1,5)naphthyridin-6-one', 'Canthin-6-one'
IUPAC Name: 1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one
Structure
SMILES: O=C1C=CC2=C3C(=CC=N2)C2=CC=CC=C2N13
InChI: InChI=1S/C14H8N2O/c17-13-6-5-11-14-10(7-8-15-11)9-3-1-2-4-12(9)16(13)14/h1-8H
InChIKey: ZERVJPYNQLONEK-UHFFFAOYSA-N
Reference
Canthin-6-one Alkaloids from<i>Brucea antidysenterica</i>Root Bark
PubChem CID: 97176
CAS: 479-43-6
LOTUS: LTS0216343
SuperNatural Ⅲ: SN0468400
COCONUT: CNP0360832
data_source: manually
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 220.231
TPSA？: 34.370000000000005
MolLogP？: 2.4387
Number of H-Donors: 0
Number of H-Acceptors: 3
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus fumigatus | Aspergillus fumigatus | MIC | 14200.0 | nM | 10.1021/np050250z |
| Bacillus cereus | Bacillus cereus | MIC | 7.81 | ug.mL-1 | 10.1016/j.bmcl.2015.11.070 |
| Bacillus subtilis | Bacillus subtilis | IZ | 8.6 | mm | 10.1021/np50028a027 |
| Bacillus subtilis | Bacillus subtilis | IZ | 16.0 | mm | 10.1021/np50028a027 |
| Candida albicans | Candida albicans | IZ | 9.0 | mm | 10.1021/np50028a027 |
| Candida albicans | Candida albicans | IZ | 13.0 | mm | 10.1021/np50028a027 |
| Candida albicans | Candida albicans | MIC | 56800.0 | nM | 10.1021/np050250z |
| Chlorocebus sabaeus | Vero | CC50 | 100000.0 | nM | 10.1021/acs.jnatprod.2c00736 |
| Cricetulus griseus | CHO | Activity | 0.0 | % | 10.1021/np50028a027 |
| Cricetulus griseus | CHO | Activity | 22.2 | % | 10.1021/np50028a027 |
| Cricetulus griseus | CHO | Activity | nan | None | 10.1021/np50028a027 |
| Cryptococcus neoformans | Cryptococcus neoformans | MIC | 14200.0 | nM | 10.1021/np050250z |
| Entamoeba histolytica | Entamoeba histolytica | IC50 | 23.0 | ug.mL-1 | 10.1007/s00044-011-9767-1 |
| Enterococcus faecalis | Enterococcus faecalis | IZ | 0.0 | mm | 10.1021/np50028a027 |
| Escherichia coli | DNA gyrase | Activity | 7.0 | % | 10.1128/aac.00392-07 |
| Escherichia coli | DNA gyrase | Activity | 12.0 | % | 10.1128/aac.00392-07 |
| Escherichia coli | DNA gyrase | Activity | 13.0 | % | 10.1128/aac.00392-07 |
| Escherichia coli | Escherichia coli | IZ | 0.0 | mm | 10.1021/np50028a027 |
| Escherichia coli | Escherichia coli | IZ | 7.0 | mm | 10.1021/np50028a027 |
| Homo sapiens | A549 | ED50 | 3.6 | ug ml-1 | 10.1021/np030277n |
| Homo sapiens | ADR5000 cell line | IC50 | 10520.0 | nM | 10.1016/j.ejmech.2021.113688 |
| Homo sapiens | Calu-3 | CC50 | 100000.0 | nM | 10.1021/acs.jnatprod.2c00736 |
| Homo sapiens | CCRF-CEM | IC50 | 15820.0 | nM | 10.1016/j.ejmech.2021.113688 |
| Homo sapiens | DU-145 | IC50 | 9.43 | ug.mL-1 | 10.1016/j.ejmech.2021.113688 |
| Homo sapiens | HCC1395 | IC50 | 8.12 | ug.mL-1 | 10.1016/j.ejmech.2021.113688 |
| Homo sapiens | HCT-8 | Activity | 55.55 | % | 10.1021/acs.jnatprod.2c00736 |
| Homo sapiens | HCT-8 | CC50 | 42410.0 | nM | 10.1021/acs.jnatprod.2c00736 |
| Homo sapiens | HeLa | Activity | 30.0 | % | 10.1021/np500516v |
| Homo sapiens | HeLa | EC50 | 15000.0 | nM | 10.1021/np500516v |
| Homo sapiens | HeLa | FC | 1.5 | None | 10.1021/np500516v |
| Homo sapiens | HeLa | FC | 3.5 | None | 10.1021/np500516v |
| Homo sapiens | HeLa | GI | 90.0 | % | 10.1021/np500516v |
| Homo sapiens | HeLa | GI | 100.0 | % | 10.1021/np500516v |
| Homo sapiens | HepG2 | CC50 | 85650.0 | nM | 10.1021/acs.jnatprod.2c00736 |
| Homo sapiens | HT-29 | Activity | 30.0 | % | 10.1021/np500516v |
| Homo sapiens | HT-29 | EC50 | 15000.0 | nM | 10.1021/np500516v |
| Homo sapiens | HT-29 | FC | 2.0 | None | 10.1021/np500516v |
| Homo sapiens | HT-29 | GI | nan | None | 10.1021/np500516v |
| Homo sapiens | Jurkat | Activity | 30.0 | % | 10.1021/np500516v |
| Homo sapiens | Jurkat | Activity | nan | None | 10.1021/np500516v |
| Homo sapiens | Jurkat | EC50 | 15000.0 | nM | 10.1021/np500516v |
| Homo sapiens | Jurkat | GI | nan | None | 10.1021/np500516v |
| Homo sapiens | KB | Activity | nan | None | 10.1021/np50045a007 |
| Homo sapiens | MCF7 | ED50 | 7.3 | ug ml-1 | 10.1021/np030277n |
| Homo sapiens | MRC5 | CC50 | 91160.0 | nM | 10.1021/acs.jnatprod.2c00736 |
| Homo sapiens | NHDF | Activity | 33.0 | % | 10.1021/np500516v |
| Homo sapiens | NHDF | Activity | 64.0 | % | 10.1021/np500516v |
| Homo sapiens | NHDF | Activity | 80.0 | % | 10.1021/np500516v |
| Homo sapiens | NHDF | EC50 | 115000.0 | nM | 10.1021/np500516v |
| Homo sapiens | PC-3 | Activity | 13.3 | % | 10.1021/np500516v |
| Homo sapiens | PC-3 | Activity | 38.1 | % | 10.1021/np500516v |
| Homo sapiens | PC-3 | Activity | 47.8 | % | 10.1021/np500516v |
| Homo sapiens | PC-3 | FC | 2.0 | None | 10.1021/np500516v |
| Homo sapiens | PC-3 | FC | 7.0 | None | 10.1021/np500516v |
| Homo sapiens | PC-3 | Inhibition | 35.0 | % | 10.1021/np500516v |
| Homo sapiens | PC-3 | Inhibition | 80.0 | % | 10.1021/np500516v |
| Homo sapiens | Protein-tyrosine phosphatase 1B | Inhibition | 15.3 | % | 10.1016/j.bmcl.2015.03.014 |
| Homo sapiens | Serine/threonine-protein kinase AKT | Inhibition | nan | % | 10.1039/C2MD20047C |
| Mus musculus | NIH3T3 | Activity | nan | None | 10.1021/np500516v |
| Mycobacterium | Mycobacterium | MIC | 2.0 | ug.mL-1 | 10.1016/j.ejmech.2017.04.003 |
| Mycolicibacterium fortuitum | Mycolicibacterium fortuitum | MIC | 16.0 | ug.mL-1 | 10.1016/j.ejmech.2018.08.027 |
| Mycolicibacterium phlei | Mycolicibacterium phlei | MIC | 8.0 | ug.mL-1 | 10.1016/j.ejmech.2018.08.027 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | MIC | 8.0 | ug.mL-1 | 10.1016/j.ejmech.2018.08.027 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 2.238 | ug.mL-1 | 10.1021/np030277n |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | IZ | 0.0 | mm | 10.1021/np50028a027 |
| Pseudomonas fluorescens | Pseudomonas fluorescens | IZ | 0.0 | mm | 10.1021/np50028a027 |
| Ralstonia solanacearum | Ralstonia solanacearum | MIC | 3.91 | ug.mL-1 | 10.1016/j.bmcl.2015.11.070 |
| Ralstonia solanacearum | Ralstonia solanacearum | MIC | 7.81 | ug.mL-1 | 10.1016/j.bmcl.2015.11.070 |
| Rattus norvegicus | C6 | Activity | 30.0 | % | 10.1021/np500516v |
| Rattus norvegicus | C6 | Activity | nan | None | 10.1021/np500516v |
| Rattus norvegicus | C6 | EC50 | 15000.0 | nM | 10.1021/np500516v |
| Rattus norvegicus | C6 | GI | nan | None | 10.1021/np500516v |
| Rattus norvegicus | GABA-A receptor; anion channel | Ki | 10000.0 | nM | 10.1021/jm00371a002 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | IZ | 9.0 | mm | 10.1021/np50028a027 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | IZ | 13.0 | mm | 10.1021/np50028a027 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 14200.0 | nM | 10.1021/np050250z |
| Staphylococcus aureus | Staphylococcus aureus | IZ | 0.0 | mm | 10.1021/np50028a027 |
| Staphylococcus aureus | Staphylococcus aureus | IZ | 10.0 | mm | 10.1021/np50028a027 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 8.0 | ug.mL-1 | 10.1016/j.ejmech.2017.04.003 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 8.0 | ug.mL-1 | 10.1016/j.ejmech.2018.08.027 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 8.0 | ug.mL-1 | 10.1016/j.ejmech.2018.10.012 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 31.25 | ug.mL-1 | 10.1016/j.bmcl.2015.11.070 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 32.0 | ug.mL-1 | 10.1016/j.ejmech.2018.08.027 |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | 7100.0 | nM | 10.1021/np050250z |
| None | ADMET | Activity | 60.0 | % | 10.1039/C2MD20047C |
| None | Keratinocyte | IC50 | 1.11 | ug.mL-1 | 10.1016/j.ejmech.2021.113688 |
| None | NON-PROTEIN TARGET | Activity | 4.2 | % | 10.1021/np980471n |
| None | NON-PROTEIN TARGET | Activity | 7.9 | % | 10.1021/np980471n |
| None | NON-PROTEIN TARGET | Activity | 30.0 | % | 10.1021/np500516v |
| None | NON-PROTEIN TARGET | Activity | 35.0 | % | 10.1039/C2MD20047C |
| None | NON-PROTEIN TARGET | Activity | 36.4 | % | 10.1021/np980471n |
| None | NON-PROTEIN TARGET | Activity | 40.0 | % | 10.1039/C2MD20047C |
| None | NON-PROTEIN TARGET | Activity | 57.3 | % | 10.1021/np980471n |
| None | NON-PROTEIN TARGET | Activity | 85.3 | % | 10.1021/np980471n |
| None | NON-PROTEIN TARGET | Activity | nan | None | 10.1039/C2MD20047C |
| None | NON-PROTEIN TARGET | EC50 | 15000.0 | nM | 10.1021/np500516v |
| None | NON-PROTEIN TARGET | GI | nan | None | 10.1021/np500516v |
| None | NON-PROTEIN TARGET | IC50 | 1.11 | ug.mL-1 | 10.1021/np50027a014 |
| None | Nucleic Acid | Activity | nan | None | 10.1128/aac.00392-07 |
| None | Unchecked | Activity | 20.0 | % | 10.1021/acs.jnatprod.2c00736 |
| None | Unchecked | IC50 | 50000.0 | nM | 10.1128/aac.00392-07 |