2-Methylaminoacetic acid
AlkaPlorer ID: AK001462
Synonym: N-Methylglycine, Sarcosine
IUPAC Name: 2-(methylamino)acetic acid
Structure
SMILES: CNCC(=O)O
InChI: InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)
InChIKey: FSYKKLYZXJSNPZ-UHFFFAOYSA-N
Reference
PubChem CID: 7311726
CAS: 107-97-1
LOTUS: LTS0202877
SuperNatural Ⅲ: SN0094728
NPASS: NPC134570
COCONUT: CNP0307073
Source
Properties Information
Molecule Weight: 89.09399999999998
TPSA?: 49.33
MolLogP?: -0.7096000000000002
Number of H-Donors: 2
Number of H-Acceptors: 2
RingCount: 0
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Escherichia coli K-12 | Beta-lactamase AmpC | Potency | 100000.0 | nM | None |
| Homo sapiens | DNA polymerase iota | Potency | 25118.9 | nM | None |
| Homo sapiens | Geminin | Potency | 183.6 | nM | None |
| Homo sapiens | Glycine transporter 1 | IC50 | 91000.0 | nM | 10.1021/acs.jmedchem.7b00956 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -5.6 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 15.91 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Proton-coupled amino acid transporter 1 | Ki | 1900000.0 | nM | 10.1016/j.bmc.2011.08.058 |
| Homo sapiens | Proton-coupled amino acid transporter 1 | pKi | -0.28 | mM | 10.1016/j.bmc.2011.08.058 |
| Homo sapiens | TAR DNA-binding protein 43 | Potency | 35481.3 | nM | None |
| Plasmodium falciparum | Plasmodium falciparum | Potency | 4147.5 | nM | None |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 0.8543 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 31.14 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 19952.62 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 20000.0 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.17 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.33 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 36.7 | % | 10.21203/rs.3.rs-23951/v1 |
| None | No relevant target | LogP | 0.03 | None | 10.1021/jm00379a002 |
| None | Unchecked | IC50 | 350000.0 | nM | 10.1021/jm00129a016 |
| None | Unchecked | Potency | 1995.3 | nM | None |
