Agelasine B
AlkaPlorer ID: AK001802
Synonym: None
IUPAC Name: 7-[(E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-9-methylpurin-9-ium-6-amine;chloride
Structure
SMILES: C[C@@H]1CC[C@@]2([C@@H]([C@@]1(C)CC/C(=C/CN3C=[N+](C4=NC=NC(=C43)N)C)/C)CCC=C2C)C.[Cl-]
InChI: InChI=1S/C26H40N5.ClH/c1-18(12-15-31-17-30(6)24-22(31)23(27)28-16-29-24)10-13-25(4)20(3)11-14-26(5)19(2)8-7-9-21(25)26;/h8,12,16-17,20-21H,7,9-11,13-15H2,1-6H3,(H2,27,28,29);1H/q+1;/p-1/b18-12+;/t20-,21-,25+,26+;/m1./s1
InChIKey: XICLOSWTCINPKX-PBGVYRNQSA-M
Reference
PubChem CID: 10049789
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Agelas citrina | Agelas | Agelasidae | Agelasida | Demospongiae | Porifera | Metazoa | Eukaryota |
| Agelas nakamurai | Agelas | Agelasidae | Agelasida | Demospongiae | Porifera | Metazoa | Eukaryota |
| Agelas mauritiana | Agelas | Agelasidae | Agelasida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 458.0940000000003
TPSA？: 60.61
MolLogP？: 2.367300000000001
Number of H-Donors: 1
Number of H-Acceptors: 4
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus niger | Aspergillus niger | Activity | nan | None | 10.1021/np970454i |
| Candida albicans | Candida albicans | IC50 | 12.5 | ug.mL-1 | 10.1021/np980173q |
| Cryptococcus neoformans | Cryptococcus neoformans | IC50 | 3.13 | ug.mL-1 | 10.1021/np980173q |
| Enterococcus faecalis | Enterococcus faecalis | IC50 | 6.25 | ug.mL-1 | 10.1021/np980173q |
| Enterococcus faecium | Enterococcus faecium | IC50 | 3.13 | ug.mL-1 | 10.1021/np980173q |
| Homo sapiens | Protein-tyrosine phosphatase 1B | IC50 | 24000.0 | nM | 10.1021/acs.jnatprod.5b00375 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IZ | 12.0 | mm | 10.1021/acs.jnatprod.5b00375 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IZ | 15.0 | mm | 10.1021/acs.jnatprod.5b00375 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | nan | None | 10.1021/np970454i |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | Activity | nan | None | 10.1021/np970454i |
| Staphylococcus aureus | Staphylococcus aureus | Activity | nan | None | 10.1021/np970454i |
| Staphylococcus aureus | Staphylococcus aureus | IC50 | 0.78 | ug.mL-1 | 10.1021/np980173q |
| Staphylococcus aureus | Staphylococcus aureus | IC50 | 3.13 | ug.mL-1 | 10.1021/np980173q |
| Staphylococcus epidermidis | Staphylococcus epidermidis | IC50 | 1.56 | ug.mL-1 | 10.1021/np980173q |
| None | NON-PROTEIN TARGET | IC50 | 19000.0 | nM | 10.1021/acs.jnatprod.5b00375 |
| None | NON-PROTEIN TARGET | IC50 | 22000.0 | nM | 10.1021/acs.jnatprod.5b00375 |