Reticulatate
AlkaPlorer ID: AK001925
Synonym: None
IUPAC Name: 2-(9H-pyrido[3,4-b]indol-2-ium-2-yl)benzoic acid;chloride
Structure
SMILES: C1=CC=C2C(=C1)C3=C(N2)C=[N+](C=C3)C4=CC=CC=C4C(=O)O.[Cl-]
InChI: InChI=1S/C18H12N2O2.ClH/c21-18(22)14-6-2-4-8-17(14)20-10-9-13-12-5-1-3-7-15(12)19-16(13)11-20;/h1-11H,(H,21,22);1H
InChIKey: PGQYNEHUGMFDRD-UHFFFAOYSA-N
Reference
PubChem CID: 44559555
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Hyrtios | Thorectidae | Dictyoceratida | Demospongiae | Porifera | Metazoa | Eukaryota |
| Fascaplysinopsis reticulata | Fascaplysinopsis | Thorectidae | Dictyoceratida | Demospongiae | Porifera | Metazoa | Eukaryota |
| None | Hyrtios | Thorectidae | Dictyoceratida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 324.76700000000005
TPSA?: 56.97
MolLogP?: 0.29999999999999954
Number of H-Donors: 2
Number of H-Acceptors: 1
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | CCRF-CEM | Activity | 350.0 | Zone units | 10.1021/np049935+ |
| Homo sapiens | LNCaP | IC50 | 25860.0 | nM | 10.1016/j.bmcl.2014.05.104 |
| Homo sapiens | LNCaP | Ratio IC50 | 0.77 | None | 10.1016/j.bmcl.2014.05.104 |
| Homo sapiens | NFF | IC50 | 19790.0 | nM | 10.1016/j.bmcl.2014.05.104 |
| Mus musculus | L1210 | Activity | 650.0 | Zone units | 10.1021/np049935+ |
| Mus musculus | MC-38 | Activity | 700.0 | Zone units | 10.1021/np049935+ |
| None | NON-PROTEIN TARGET | Activity | 500.0 | Zone units | 10.1021/np049935+ |
| None | NON-PROTEIN TARGET | Activity | 650.0 | Zone units | 10.1021/np049935+ |
