Dubermatinib
AlkaPlorer ID: AK002161
Synonym: None
IUPAC Name: 2-[[5-chloro-2-[4-[(4-methylpiperazin-1-yl)methyl]anilino]pyrimidin-4-yl]amino]-N,N-dimethylbenzenesulfonamide
Structure
SMILES: CN1CCN(CC1)CC2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4S(=O)(=O)N(C)C)Cl
InChI: InChI=1S/C24H30ClN7O2S/c1-30(2)35(33,34)22-7-5-4-6-21(22)28-23-20(25)16-26-24(29-23)27-19-10-8-18(9-11-19)17-32-14-12-31(3)13-15-32/h4-11,16H,12-15,17H2,1-3H3,(H2,26,27,28,29)
InChIKey: YUAALFPUEOYPNX-UHFFFAOYSA-N
Reference
A novel conversion of norditerpenoid alkaloids into aconane-type diterpenes
PubChem CID: 56839178
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Delphinium | Ranunculaceae | Ranunculales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | Delphinium | Ranunculaceae | Ranunculales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 516.0710000000003
TPSA?: 93.7
MolLogP?: 3.6149000000000022
Number of H-Donors: 2
Number of H-Acceptors: 8
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | ALK tyrosine kinase receptor | Inhibition | 80.0 | % | 10.1021/ml200198x |
| Homo sapiens | Bromodomain-containing protein 4 | Delta TM | -0.09683 | C | None |
| Homo sapiens | Casein kinase I delta | Delta TM | -0.02658 | C | None |
| Homo sapiens | Cyclin-dependent kinase 2 | Delta TM | 3.981 | C | None |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 101.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 106.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 107.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 108.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 110.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 125.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 43.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 65.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 70.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 83.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 85.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 87.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 91.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 115.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 116.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 122.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 125.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 126.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 129.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 133.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 137.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 169.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 222.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast growth factor receptor 3 | Delta TM | 4.515 | C | None |
| Homo sapiens | Glycogen synthase kinase-3 beta | Delta TM | 5.915 | C | None |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 233.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 256.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 274.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 293.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 322.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 351.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 594.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 58.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 158.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 174.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 205.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 206.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 210.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 214.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 222.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 258.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 259.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 267.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 270.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 284.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 288.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 290.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 297.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 316.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HepG2 | IC50 relative | 11200.0 | nM | 10.6019/EOS300108 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -1.57 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 5.09 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | MAP kinase ERK2 | Delta TM | 1.473 | C | None |
| Homo sapiens | Peregrin | Delta TM | 0.955 | C | None |
| Homo sapiens | Proto-oncogene tyrosine-protein kinase MER | Inhibition | 80.0 | % | 10.1021/ml200198x |
| Homo sapiens | PSN1 | Activity | nan | None | 10.1021/ml200198x |
| Homo sapiens | PSN1 | IC50 | 60.0 | nM | 10.1021/ml200198x |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | Delta TM | 0.0 | C | None |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | IC50 | 3.0 | nM | 10.1021/ml200198x |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | Inhibition | 80.0 | % | 10.1021/ml200198x |
| Homo sapiens | Serine/threonine-protein kinase Aurora-B | IC50 | 12.4 | nM | 10.1021/ml200198x |
| Homo sapiens | Serine/threonine-protein kinase Aurora-B | Inhibition | 50.0 | % | 10.1021/ml200198x |
| Homo sapiens | Serine/threonine-protein kinase Aurora-B | Inhibition | nan | % | 10.1021/ml200198x |
| Homo sapiens | Serine/threonine-protein kinase Chk1 | Inhibition | 50.0 | % | 10.1021/ml200198x |
| Homo sapiens | Transcription intermediary factor 1-alpha | Delta TM | -0.09879 | C | None |
| Homo sapiens | Tyrosine-protein kinase ABL | Delta TM | 5.217 | C | None |
| Homo sapiens | Tyrosine-protein kinase ABL | Inhibition | 80.0 | % | 10.1021/ml200198x |
| Homo sapiens | Tyrosine-protein kinase JAK2 | Inhibition | 80.0 | % | 10.1021/ml200198x |
| Homo sapiens | Tyrosine-protein kinase receptor TYRO3 | Inhibition | 80.0 | % | 10.1021/ml200198x |
| Homo sapiens | Tyrosine-protein kinase receptor UFO | EC50 | 222.0 | nM | 10.1021/ml200198x |
| Homo sapiens | Tyrosine-protein kinase receptor UFO | EC50 | 305.0 | nM | 10.1021/ml200198x |
| Homo sapiens | Tyrosine-protein kinase receptor UFO | IC50 | 15.0 | nM | 10.1039/d2md00153e |
| Homo sapiens | Tyrosine-protein kinase receptor UFO | IC50 | 27.0 | nM | 10.1021/ml200198x |
| Homo sapiens | Tyrosine-protein kinase receptor UFO | Inhibition | 80.0 | % | 10.1021/ml200198x |
| Homo sapiens | Tyrosine-protein kinase receptor UFO | Inhibition | nan | % | 10.1021/ml200198x |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 43.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 102.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 152.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 153.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 165.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 212.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 330.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 55.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 79.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 91.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 57.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 65.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 70.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 80.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 87.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 91.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 104.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 140.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 146.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 147.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 150.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 165.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 172.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 188.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 217.0 | None | 10.6019/CHEMBL4689842 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | -1.131 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 4.46 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 19952.62 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 20000.0 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 2.54 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 6.51 | % | 10.21203/rs.3.rs-23951/v1 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 7.76 | % | 10.6019/CHEMBL4495565 |
| None | ADMET | AUC | 158.0 | ng.hr.mL-1 | 10.1039/d2md00153e |
| None | ADMET | AUC | 187.0 | ng.hr.mL-1 | 10.1039/d2md00153e |
| None | ADMET | CL | 0.08283 | mL.min-1.kg-1 | 10.1039/d2md00153e |
| None | ADMET | CL | 20.1 | mL.min-1.kg-1 | 10.1039/d2md00153e |
| None | ADMET | CL | 50.4 | mL.min-1.kg-1 | 10.1039/d2md00153e |
| None | ADMET | CL | 581.9 | mL.min-1.kg-1 | 10.1039/d2md00153e |
| None | ADMET | CL | 645.7 | mL.min-1.kg-1 | 10.1039/d2md00153e |
| None | ADMET | Cmax | 90.69 | nM | 10.1039/d2md00153e |
| None | ADMET | Cmax | 174.01 | nM | 10.1039/d2md00153e |
| None | ADMET | F | 21.5 | % | 10.1039/d2md00153e |
| None | ADMET | T1/2 | 0.045 | hr | 10.1039/d2md00153e |
| None | ADMET | T1/2 | 0.07167 | hr | 10.1039/d2md00153e |
| None | ADMET | T1/2 | 1.77 | hr | 10.1039/d2md00153e |
| None | ADMET | T1/2 | 2.94 | hr | 10.1039/d2md00153e |
