6-acetonyldihydrochelerythrine
AlkaPlorer ID: AK002327
Synonym: None
IUPAC Name: 1-[(13S)-1,2-dimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl]propan-2-one
Structure
SMILES: COC1=CC=C2C3=CC=C4C=C5OCOC5=CC4=C3N(C)[C@@H](CC(C)=O)C2=C1OC
InChI: InChI=1S/C24H23NO5/c1-13(26)9-18-22-15(7-8-19(27-3)24(22)28-4)16-6-5-14-10-20-21(30-12-29-20)11-17(14)23(16)25(18)2/h5-8,10-11,18H,9,12H2,1-4H3/t18-/m0/s1
InChIKey: VGTQLFWIJIABSU-SFHVURJKSA-N
Reference
Alcaloïdes de Zanthoxylum tsihanimposa
PubChem CID: 185516
LOTUS: LTS0167510
SuperNatural Ⅲ: SN0389878-02
NPASS: NPC193906
data_source: manually
Source
Properties Information
Molecule Weight: 405.45000000000016
TPSA?: 57.23
MolLogP?: 4.722700000000004
Number of H-Donors: 0
Number of H-Acceptors: 6
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Chlorocebus sabaeus | Vero | IC50 | 15300.0 | nM | 10.1021/np0702281 |
| Homo sapiens | HCT-116 | Activity | 19.0 | % | 10.1021/np500161n |
| Homo sapiens | HCT-116 | Activity | 22.0 | % | 10.1021/np500161n |
| Homo sapiens | HCT-116 | Activity | nan | None | 10.1021/np500161n |
| Homo sapiens | SW-620 | Activity | 22.0 | % | 10.1021/np500161n |
| Homo sapiens | SW-620 | Activity | 27.0 | % | 10.1021/np500161n |
| Homo sapiens | SW-620 | Activity | 34.0 | % | 10.1021/np500161n |
| Homo sapiens | SW-620 | Activity | 65.0 | % | 10.1021/np500161n |
| Homo sapiens | SW-620 | Activity | nan | None | 10.1021/np500161n |
| Homo sapiens | SW-620 | FC | 1.1 | None | 10.1021/np500161n |
| Homo sapiens | SW-620 | IC50 | 3800.0 | nM | 10.1021/np500161n |
| Leishmania donovani | Leishmania donovani | Activity | 57.4 | % | 10.1021/np0702281 |
| Leishmania donovani | Leishmania donovani | IC50 | 6600.0 | nM | 10.1021/np0702281 |
| Leishmania donovani | Leishmania donovani | Inhibition | 23.0 | % | 10.1021/np0702281 |
| Leishmania donovani | Leishmania donovani | Inhibition | 87.0 | % | 10.1021/np0702281 |
| Leishmania donovani | Leishmania donovani | Inhibition | 100.0 | % | 10.1021/np0702281 |
| Trypanosoma brucei brucei | Trypanosoma brucei brucei | IC50 | 3900.0 | nM | 10.1021/np0702281 |
| None | NON-PROTEIN TARGET | Activity | 25.0 | % | 10.1021/np500161n |
| None | NON-PROTEIN TARGET | Activity | 65.0 | % | 10.1021/np500161n |
| None | NON-PROTEIN TARGET | FC | 1.2 | None | 10.1021/np500161n |
| None | NON-PROTEIN TARGET | FC | 1.3 | None | 10.1021/np500161n |
| None | NON-PROTEIN TARGET | IC50 | 2400.0 | nM | 10.1021/np500161n |
