Fagomine
AlkaPlorer ID: AK004770
Synonym: '', '3-epifagomine', '3-epi-fagomine', '(-)-3,4-di-epi-fagomine', 'Fagomine', '3,4-di-epi-fagomine', '3-epi-Fagomine'
IUPAC Name: (2R,3S,4S)-2-(hydroxymethyl)piperidine-3,4-diol
Structure
SMILES: OC[C@H]1NCC[C@H](O)[C@H]1O
InChI: InChI=1S/C6H13NO3/c8-3-4-6(10)5(9)1-2-7-4/h4-10H,1-3H2/t4-,5+,6+/m1/s1
InChIKey: YZNNBIPIQWYLDM-SRQIZXRXSA-N
Reference
Fagomine Isomers and Glycosides from <i>Xanthocercis zambesiaca</i>
PubChem CID: 10678391
LOTUS: LTS0076554
SuperNatural Ⅲ: SN0464469-04
NPASS: NPC193593
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Xanthocercis zambesiaca | Xanthocercis | Fabaceae | Fabales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 147.174
TPSA？: 72.72
MolLogP？: -1.937599999999999
Number of H-Donors: 4
Number of H-Acceptors: 4
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bos taurus | Alpha-L-fucosidase 1 | Inhibition | 50.0 | % | 10.1016/j.bmc.2011.04.011 |
| Bos taurus | Beta-galactosidase | Inhibition | 50.0 | % | 10.1016/j.bmc.2011.04.011 |
| Bos taurus | Glucosylceramidase | Inhibition | 50.0 | % | 10.1016/j.bmc.2011.04.011 |
| Homo sapiens | Beta-glucocerebrosidase | Inhibition | 50.0 | % | 10.1016/j.bmc.2011.04.011 |
| Homo sapiens | Beta-glucosidase | IC50 | 1000000.0 | nM | 10.1021/ml200050s |
| Mus musculus | Ceramide glucosyltransferase | IC50 | 10000.0 | nM | 10.1021/ml200050s |
| Mus musculus | Ceramide glucosyltransferase | Inhibition | nan | % | 10.1021/ml200050s |
| Rattus norvegicus | Lactase-glycosylceramidase | Inhibition | 50.0 | % | 10.1016/j.bmc.2011.04.011 |
| Rattus norvegicus | Sucrase-isomaltase | Inhibition | 50.0 | % | 10.1016/j.bmc.2011.04.011 |
| Rattus norvegicus | Sucrase-isomaltase | Inhibition | 50.0 | % | 10.1021/np960646y |
| None | Unchecked | IC50 | 1000000.0 | nM | 10.1021/ml200050s |
| None | Unchecked | Inhibition | 50.0 | % | 10.1016/j.bmc.2011.04.011 |
| None | Unchecked | Inhibition | 50.0 | % | 10.1021/np960646y |