Epicorazine A
AlkaPlorer ID: AK005696
Synonym: None
IUPAC Name: (1R,4S,5S,9S,11R,14S,15S,19S)-5,15-dihydroxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docosa-6,16-diene-2,8,12,18-tetrone
Structure
SMILES: O=C1C=C[C@H](O)[C@@H]2[C@@H]1C[C@@]13SS[C@]4(C[C@@H]5C(=O)C=C[C@H](O)[C@H]5N4C1=O)C(=O)N23
InChI: InChI=1S/C18H16N2O6S2/c21-9-1-3-11(23)13-7(9)5-17-15(25)20-14-8(10(22)2-4-12(14)24)6-18(20,28-27-17)16(26)19(13)17/h1-4,7-8,11-14,23-24H,5-6H2/t7-,8-,11+,12+,13+,14+,17-,18-/m1/s1
InChIKey: RCODXLGTKJXDNC-UORGKRBOSA-N
Source
Properties Information
Molecule Weight: 420.4680000000001
TPSA?: 115.21999999999998
MolLogP?: -0.7786000000000002
Number of H-Donors: 2
Number of H-Acceptors: 8
RingCount: 7
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Enterococcus faecalis | Enterococcus faecalis | Inhibition | nan | % | 10.1021/np200857y |
| Escherichia coli | Escherichia coli | Inhibition | nan | % | 10.1021/np200857y |
| Haemophilus influenzae | Haemophilus influenzae | MIC | 0.5 | ug.mL-1 | 10.1021/np200857y |
| Homo sapiens | A549 | IC50 | 2300.0 | nM | 10.1021/np400802d |
| Homo sapiens | HCT-116 | IC50 | 330.0 | nM | 10.1021/np400802d |
| Homo sapiens | HL-60 | IC50 | 50.0 | nM | 10.1021/np400802d |
| Homo sapiens | K562 | IC50 | 1500.0 | nM | 10.1021/np400802d |
| Homo sapiens | MGC-803 | IC50 | 2700.0 | nM | 10.1021/np400802d |
| Staphylococcus aureus | Staphylococcus aureus | Inhibition | nan | % | 10.1021/np200857y |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 32.0 | ug.mL-1 | 10.1021/np200857y |
| Staphylococcus aureus | Staphylococcus aureus | Ratio | 8.0 | None | 10.1021/np200857y |
| Streptococcus pneumoniae | Streptococcus pneumoniae | Inhibition | nan | % | 10.1021/np200857y |
