5-Hydroxynoracronycine
AlkaPlorer ID: AK005924
Synonym: '7H-Pyrano2,3-cacridin-7-one, 3,12-dihydro-6,11-dihydroxy-3,3,12-trimethyl-', '"5-hydroxynoracronycine'
IUPAC Name: 6,11-dihydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one
Structure
SMILES: CN1C2=C(O)C=CC=C2C(=O)C2=C(O)C=C3OC(C)(C)C=CC3=C21
InChI: InChI=1S/C19H17NO4/c1-19(2)8-7-10-14(24-19)9-13(22)15-17(10)20(3)16-11(18(15)23)5-4-6-12(16)21/h4-9,21-22H,1-3H3
InChIKey: JZQDCDLYNFZBIG-UHFFFAOYSA-N
Reference
Acridone alkaloids as potent inhibitors of cathepsin V
PubChem CID: 5378702
CAS: 27067-70-5
LOTUS: LTS0148605
SuperNatural Ⅲ: SN0179654
COCONUT: CNP0359913
data_source: manually
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Citrus maxima | Citrus | Rutaceae | Sapindales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 323.348
TPSA？: 71.69000000000001
MolLogP？: 3.2871000000000024
Number of H-Donors: 2
Number of H-Acceptors: 5
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Chlorocebus sabaeus | Vero | IC50 | 9.3 | ug.mL-1 | 10.1021/np2004825 |
| Homo sapiens | A549 | IC50 | 40000.0 | nM | 10.1021/np980504z |
| Homo sapiens | Cathepsin L2 | IC50 | 48000.0 | nM | 10.1016/j.bmc.2010.12.056 |
| Homo sapiens | CCRF-HSB-2 | IC50 | 23600.0 | nM | 10.1021/np980504z |
| Homo sapiens | HeLa | ED50 | 78.0 | uM | 10.1021/np0005762 |
| Homo sapiens | HeLa | ED50 | 85.5 | uM | 10.1021/np0005762 |
| Homo sapiens | TGBC11TKB | IC50 | 16200.0 | nM | 10.1021/np980504z |
| Leishmania donovani | Leishmania donovani | EC50 | 11.2 | ug.mL-1 | 10.1021/np2004825 |
| Mus musculus | B16 | IC50 | 40000.0 | nM | 10.1021/np980504z |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 0.9 | ug.mL-1 | 10.1021/np2004825 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 6800.0 | nM | 10.1021/np0005762 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 8700.0 | nM | 10.1021/np0005762 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 10200.0 | nM | 10.1021/np0005762 |
| Plasmodium falciparum | Plasmodium falciparum | IC50 | 11100.0 | nM | 10.1021/np0005762 |
| Trypanosoma brucei brucei | Trypanosoma brucei brucei | EC50 | 125.0 | ug.mL-1 | 10.1021/np2004825 |
| None | Unchecked | Ratio | 7.7 | None | 10.1021/np0005762 |
| None | Unchecked | Ratio | 9.0 | None | 10.1021/np0005762 |
| None | Unchecked | Ratio IC50 | 10.0 | None | 10.1021/np2004825 |