7,8-Dehydro-19beta-hydroxyschizozygine
AlkaPlorer ID: AK006083
Synonym: ''
IUPAC Name: (1S,2R,18S,19R)-2-hydroxy-8,10-dioxa-4,17-diazaheptacyclo[15.4.3.01,18.04,19.05,13.07,11.014,19]tetracosa-5,7(11),12,14,22-pentaen-3-one
Structure
SMILES: O=C1[C@H](O)[C@]23C=CCN4CC=C5C6=CC7=C(C=C6N1[C@@]5(CC2)[C@@H]43)OCO7
InChI: InChI=1S/C20H18N2O4/c23-16-17(24)22-13-9-15-14(25-10-26-15)8-11(13)12-2-7-21-6-1-3-19(16)4-5-20(12,22)18(19)21/h1-3,8-9,16,18,23H,4-7,10H2/t16-,18-,19-,20+/m0/s1
InChIKey: ZBFUQTFEXPQKQZ-FRYIKTPZSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Schizozygia | Apocynaceae | Gentianales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 350.3740000000002
TPSA？: 62.24000000000001
MolLogP？: 1.2928000000000002
Number of H-Donors: 1
Number of H-Acceptors: 5
RingCount: 7
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Candida albicans | Candida albicans | MIC | 7.8 | ug.mL-1 | 10.1021/np010298m |
| Cladosporium cladosporioides | Cladosporium cladosporioides | MIC | 7.8 | ug.mL-1 | 10.1021/np010298m |
| Cladosporium herbarum | Cladosporium herbarum | MIC | 15.6 | ug.mL-1 | 10.1021/np010298m |
| Epidermophyton floccosum | Epidermophyton floccosum | MIC | 1.95 | ug.mL-1 | 10.1021/np010298m |
| Escherichia coli | Escherichia coli | MIC | 250.0 | ug.mL-1 | 10.1021/np010298m |
| Nannizzia gypsea | Nannizzia gypsea | MIC | 1.95 | ug.mL-1 | 10.1021/np010298m |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 500.0 | ug.mL-1 | 10.1021/np010298m |
| Trichophyton interdigitale | Trichophyton interdigitale | MIC | 3.9 | ug.mL-1 | 10.1021/np010298m |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | 1.95 | ug.mL-1 | 10.1021/np010298m |
| Trichophyton tonsurans | Trichophyton tonsurans | MIC | 3.9 | ug.mL-1 | 10.1021/np010298m |