Periglaucine B
AlkaPlorer ID: AK006746
Synonym: 'periglaucine B', '(+)-Periglaucine A', '(7alpha,8beta,10beta)-8,10-epoxy-7,8-dimethoxy-2,3-methylenebis(oxy)-17-methyl-6-oxohasubanan', '(+)-Periglaucine B', 'periglaucine A', 'Periglaucine A', '(7beta,8beta,10beta)-8,10-epoxy-7,8-dimethoxy-2,3-methylenebis(oxy)-17-methyl-6-oxohasubanan', 'Periglaucine B'
IUPAC Name: (1S,11R,13S,14S,15S)-14,15-dimethoxy-20-methyl-5,7,21-trioxa-20-azahexacyclo[11.4.3.111,14.01,13.02,10.04,8]henicosa-2,4(8),9-trien-16-one
Structure
SMILES: CO[C@H]1C(=O)C[C@]23CCN(C)[C@@]24C[C@@H](O[C@]14OC)C1=CC2=C(C=C13)OCO2
InChI: InChI=1S/C20H23NO6/c1-21-5-4-18-8-13(22)17(23-2)20(24-3)19(18,21)9-16(27-20)11-6-14-15(7-12(11)18)26-10-25-14/h6-7,16-17H,4-5,8-10H2,1-3H3/t16-,17+,18+,19+,20-/m1/s1
InChIKey: QJDYNQYLCIPODD-JAZQRGJZSA-N
Reference
Periglaucines A−D, Anti-HBV and -HIV-1 Alkaloids from <i>Pericampylus glaucus</i>
PubChem CID: 44577169
LOTUS: LTS0096034
NPASS: NPC474432
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Pericampylus glaucus | Pericampylus | Menispermaceae | Ranunculales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 373.40500000000014
TPSA?: 66.46000000000001
MolLogP?: 1.5329
Number of H-Donors: 0
Number of H-Acceptors: 7
RingCount: 6
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Hepatitis B virus | Hepatitis B virus | IC50 | 470000.0 | nM | 10.1021/np070479+ |
| Hepatitis B virus | Hepatitis B virus | IC50 | 3090000.0 | nM | 10.1021/np070479+ |
| Homo sapiens | C8166 | CC50 | 536000.0 | nM | 10.1021/np070479+ |
| Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | 388600.0 | nM | 10.1021/np070479+ |
| None | ADMET | CC50 | 640000.0 | nM | 10.1021/np070479+ |
| None | Unchecked | Ratio CC50/EC50 | 1.61 | None | 10.1021/np070479+ |
| None | Unchecked | Ratio CC50/IC50 | 1.0 | None | 10.1021/np070479+ |
| None | Unchecked | Ratio CC50/IC50 | 1.36 | None | 10.1021/np070479+ |
