2,5-Dideoxy-2,5-imino-glycero-D-manno-heptitol
AlkaPlorer ID: AK007067
Synonym: ''
IUPAC Name: (2R,3R,4R,5R)-2-[(1R)-1,2-dihydroxyethyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol
Structure
SMILES: OC[C@H](O)[C@H]1N[C@H](CO)[C@@H](O)[C@@H]1O
InChI: InChI=1S/C7H15NO5/c9-1-3-6(12)7(13)5(8-3)4(11)2-10/h3-13H,1-2H2/t3-,4+,5-,6-,7-/m1/s1
InChIKey: ZJRUOSSQTZGFJV-IECVIRLLSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Scilla | Hyacinthaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 193.19900000000004
TPSA？: 113.18
MolLogP？: -3.605899999999999
Number of H-Donors: 6
Number of H-Acceptors: 6
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bos taurus | Alpha-L-fucosidase 1 | Inhibition | 50.0 | % | 10.1021/np020296h |
| Bos taurus | Beta-galactosidase | IC50 | 4400.0 | nM | 10.1021/np020296h |
| Caldicellulosiruptor saccharolyticus | Beta-glucosidase A | IC50 | 3200.0 | nM | 10.1021/np020296h |
| Rattus norvegicus | Acidic alpha-glucosidase | IC50 | 400000.0 | nM | 10.1021/np020296h |
| Rattus norvegicus | Acidic alpha-glucosidase | Inhibition | 50.0 | % | 10.1021/np020296h |
| Rattus norvegicus | Beta-mannosidase | IC50 | 53000.0 | nM | 10.1021/np020296h |
| Saccharomyces cerevisiae S288c | Oligo-1,6-glucosidase | IC50 | 220000.0 | nM | 10.1021/np020296h |
| None | Unchecked | IC50 | 95000.0 | nM | 10.1021/np020296h |
| None | Unchecked | Inhibition | 50.0 | % | 10.1021/np020296h |