S-methylcysteine
AlkaPlorer ID: AK007338
Synonym: 'S-methyl-L-cysteine', 'S-Methyl cysteine', '3-(Methylthio)-L-alanine', '(2R)-2-amino-3-(methylsulfanyl)propanoic acid', '(R)-2-amino-3-(methylthio)propanoic acid', 'L-S-methylcysteine', 'L-Methylcysteine', 'S-Methyl-L-cysteine', 'S-METHYLCYSTEINE'
IUPAC Name: (2R)-2-amino-3-methylsulfanylpropanoic acid
Structure
SMILES: CSC[C@H](N)C(=O)O
InChI: InChI=1S/C4H9NO2S/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1
InChIKey: IDIDJDIHTAOVLG-VKHMYHEASA-N
Reference
PubChem CID: 7058174
CAS: 1187-84-4
LOTUS: LTS0201907
SuperNatural Ⅲ: SN0142552-02
NPASS: NPC204364
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Homo sapiens | Homo | Hominidae | Primates | Mammalia | Chordata | Metazoa | Eukaryota |
| Allium sativum | Allium | Amaryllidaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Allium cepa | Allium | Amaryllidaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 135.18800000000002
TPSA?: 63.32000000000001
MolLogP?: -0.2387000000000002
Number of H-Donors: 2
Number of H-Acceptors: 3
RingCount: 0
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | HeLa | IC50 | 50000.0 | nM | 10.1016/j.bmcl.2007.04.101 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -4.29 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 15.31 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Kinesin-like protein 1 | IC50 | 63000.0 | nM | 10.1016/j.bmcl.2007.04.101 |
| Rattus norvegicus | Amino acid transporter | Inhibition | 25.0 | % | None |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 13.48 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.04 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 37.27 | % | 10.21203/rs.3.rs-23951/v1 |
