Deoxymannojirimycin
AlkaPlorer ID: AK007567
Synonym: None
IUPAC Name: (2R,3R,4R,5R)-2-(hydroxymethyl)piperidine-3,4,5-triol
Structure
SMILES: OC[C@H]1NC[C@@H](O)[C@@H](O)[C@@H]1O
InChI: InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4-,5-,6-/m1/s1
InChIKey: LXBIFEVIBLOUGU-KVTDHHQDSA-N
Reference
Novel α‐L‐fucosidase inhibitors from the bark of <i>Angylocalyx pynaertii</i> (Leguminosae)
PubChem CID: 72258
CAS: 84444-90-6
LOTUS: LTS0245637
SuperNatural Ⅲ: SN0217761-05
NPASS: NPC22774
{NPAtlas: NPA020720
Source
Properties Information
Molecule Weight: 163.173
TPSA?: 92.95
MolLogP?: -2.9667999999999988
Number of H-Donors: 5
Number of H-Acceptors: 5
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Aspergillus niger | Alpha-galactosidase C | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Bacteroides thetaiotaomicron | GH92 alpha-mannosidase | Ki | 12000000.0 | nM | 10.1038/nchembio.278 |
| Bacteroides thetaiotaomicron | GH92 alpha-mannosidase | Ki | 13000000.0 | nM | 10.1038/nchembio.278 |
| Bos taurus | Alpha-L-fucosidase 1 | IC50 | 39000.0 | nM | 10.1021/jm0495881 |
| Bos taurus | Alpha-L-fucosidase 1 | Ki | 4700.0 | nM | 10.1021/jm0495881 |
| Bos taurus | Beta-galactosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Coffea arabica | Alpha-galactosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Glycine max | Alpha-mannosidase | IC50 | 840000.0 | nM | 10.1021/jm0495881 |
| Glycine max | Alpha-mannosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Glycine max | Alpha-mannosidase | Ki | 18000.0 | nM | 10.1016/j.bmcl.2006.01.095 |
| Homo sapiens | Alpha-galactosidase A | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Homo sapiens | Alpha-L-fucosidase I | IC50 | 221000.0 | nM | 10.1021/jm0495881 |
| Homo sapiens | Alpha-L-fucosidase I | Ki | 4700.0 | nM | 10.1021/jm970836l |
| Homo sapiens | Alpha-L-fucosidase I | Ki | 30000.0 | nM | 10.1016/S0960-894X(00)80649-6 |
| Homo sapiens | Beta-galactosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Homo sapiens | Beta-glucosidase cytosolic | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Homo sapiens | Beta-mannosidase | Activity | nan | None | 10.1016/S0960-894X(00)80648-4 |
| Homo sapiens | Beta-mannosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Homo sapiens | Epididymis-specific alpha-mannosidase | IC50 | 560000.0 | nM | 10.1021/jm0495881 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 1.13 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | 1.15 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Lysosomal alpha-glucosidase | Potency | 28183.8 | nM | None |
| Homo sapiens | Lysosomal alpha-mannosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Homo sapiens | Maltase-glucoamylase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Homo sapiens | Neutral alpha-glucosidase AB | Activity | nan | None | 10.1016/S0960-894X(00)80648-4 |
| Homo sapiens | PBMC | Inhibition | 8.8 | % | 10.1016/j.bmcl.2011.10.081 |
| Homo sapiens | PBMC | Inhibition | nan | % | 10.1016/j.bmcl.2011.10.081 |
| Homo sapiens | Thyroid hormone receptor beta-1 | Potency | 1778.3 | nM | None |
| Homo sapiens | Tyrosine-protein kinase JAK1 | Inhibition | nan | % | 10.1016/j.bmcl.2011.10.081 |
| Oryza sativa Japonica Group | Alpha-glucosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Rattus norvegicus | Beta-galactosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Rattus norvegicus | Beta-mannosidase | Inhibition | 50.0 | % | 10.1021/jm0495881 |
| Rattus norvegicus | Sucrase-isomaltase | IC50 | 110000.0 | nM | 10.1021/jm0495881 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 18.75 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 19952.62 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 20000.0 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.11 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 8.77 | % | 10.21203/rs.3.rs-23951/v1 |
| None | T-cell | Activity | 1.5 | % | 10.1016/j.bmcl.2011.10.081 |
| None | Unchecked | Activity | nan | None | 10.1021/np50098a020 |
| None | Unchecked | Ki | 33000000.0 | nM | 10.1038/nchembio.81 |
