Pavettine
AlkaPlorer ID: AK008768
Synonym: None
IUPAC Name: 1-ethenyl-9H-carbazole
Structure
SMILES: C=CC1=C2C(=CC=C1)C3=CC=CC=C3N2
InChI: InChI=1S/C14H11N/c1-2-10-6-5-8-12-11-7-3-4-9-13(11)15-14(10)12/h2-9,15H,1H2
InChIKey: APQXWKHOGQFGTB-UHFFFAOYSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Quassia amara | Quassia | Simaroubaceae | Sapindales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 193.249
TPSA？: 15.79
MolLogP？: 3.964100000000002
Number of H-Donors: 1
Number of H-Acceptors: 0
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Amorphotheca resinae | Amorphotheca resinae | MIC | 0.9 | ug | 10.1021/np50076a023 |
| Bacillus subtilis | Bacillus subtilis | MIC | 1.9 | ug | 10.1021/np50076a023 |
| Candida albicans | Candida albicans | MIC | 1.9 | ug | 10.1021/np50076a023 |
| Escherichia coli | Escherichia coli | MIC | 30.0 | ug | 10.1021/np50076a023 |
| Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | IZ | 1.0 | mm | 10.1021/np50076a023 |
| Human alphaherpesvirus 1 | Human alphaherpesvirus 1 | IZ | nan | None | 10.1021/np50076a023 |
| Mus musculus | P388 | IC50 | 0.1 | ug.mL-1 | 10.1021/np50076a023 |
| Poliovirus 1 | Poliovirus 1 | IZ | 1.0 | mm | 10.1021/np50076a023 |
| Poliovirus 1 | Poliovirus 1 | IZ | nan | None | 10.1021/np50076a023 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 60.0 | ug | 10.1021/np50076a023 |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | 0.1 | ug | 10.1021/np50076a023 |
| None | ADMET | IZ | 2.0 | mm | 10.1021/np50076a023 |
| None | ADMET | IZ | nan | None | 10.1021/np50076a023 |