Se-methylselenocysteine
AlkaPlorer ID: AK010915
Synonym: '', '3-(Methylseleno)alanine', 'Selenohomocysteine', 'Se-Methylselenocysteine', 'Se-methyl-L-selenocysteine', 'Selenium methyl cysteine', 'Se-Methyl-selenocysteine', 'Selenomethylselenocysteine'
IUPAC Name: (2R)-2-amino-3-methylselanylpropanoic acid
Structure
SMILES: C[Se]C[C@H](N)C(=O)O
InChI: InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1
InChIKey: XDSSPSLGNGIIHP-VKHMYHEASA-N
Reference
PubChem CID: 147004
CAS: 26046-90-2
LOTUS: LTS0228008
SuperNatural Ⅲ: SN0427380-01
NPASS: NPC53449
Source
Properties Information
Molecule Weight: 182.081
TPSA?: 63.32000000000001
MolLogP?: -0.4311000000000003
Number of H-Donors: 2
Number of H-Acceptors: 2
RingCount: 0
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Cricetulus griseus | V79 | IC50 | 472000.0 | nM | 10.1021/jm020496q |
| Homo sapiens | A-375 | IC50 | 54000.0 | nM | 10.1016/j.ejmech.2021.113621 |
| Homo sapiens | Amyloid-beta A4 protein | Potency | 18356.4 | nM | None |
| Homo sapiens | Ataxin-2 | Potency | 19952.6 | nM | None |
| Homo sapiens | ATPase family AAA domain-containing protein 5 | Potency | 29081.0 | nM | None |
| Homo sapiens | HEK293 | Potency | 29081.0 | nM | None |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -10.37 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone deacetylase 6 | Inhibition | -1.23 | % | 10.6019/CHEMBL4808148 |
| Homo sapiens | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Potency | 631.0 | nM | None |
| Homo sapiens | Hs68 | IC50 | 50000.0 | nM | 10.1016/j.ejmech.2021.113621 |
| Homo sapiens | Kynurenine--oxoglutarate transaminase I | Specific activity | 4.0 | nM min-1 mg-1 | 10.1021/jm950750x |
| Homo sapiens | MCF7 | IC50 | 193000.0 | nM | 10.1016/j.ejmech.2021.113621 |
| Homo sapiens | Nuclear factor erythroid 2-related factor 2 | Potency | 16360.1 | nM | None |
| Homo sapiens | Regulator of G-protein signaling 4 | Potency | 26679.5 | nM | None |
| Homo sapiens | SW-620 | IC50 | 632800.0 | nM | 10.1016/j.ejmech.2021.113621 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IC50 | 600.0 | nM | 10.1128/aac.00803-09 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IC50 | 2190.0 | nM | 10.1128/aac.00803-09 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | IC50 | 50000.0 | nM | 10.1128/aac.00803-09 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | MIC | 12500.0 | nM | 10.1128/aac.00803-09 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | MIC | 50000.0 | nM | 10.1128/aac.00803-09 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | Potency | 20596.2 | nM | None |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 12.51 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.05 | % | 10.6019/CHEMBL4495565 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 9.2 | % | 10.21203/rs.3.rs-23951/v1 |
| None | Unchecked | Fold induction | 1.5 | None | 10.1021/jm020496q |
