Ceramide
AlkaPlorer ID: AK013917
Synonym: None
IUPAC Name: N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide
Structure
SMILES: CCCCCCCCCCCCCCC[C@@H](O)[C@H](CO)NC(C)=O
InChI: InChI=1S/C20H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)19(17-22)21-18(2)23/h19-20,22,24H,3-17H2,1-2H3,(H,21,23)/t19-,20+/m0/s1
InChIKey: CRJGESKKUOMBCT-VQTJNVASSA-N
Reference
Ceramide and Cerebrosides from the Octocoral <i>Sarcophyton ehrenbergi</i>
PubChem CID: 6610273
CAS: 13031-64-6
LOTUS: LTS0023784
SuperNatural Ⅲ: SN0053555-01
NPASS: NPC270041
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Sarcophyton ehrenbergi | Sarcophyton | Alcyoniidae | Malacalcyonacea | Anthozoa | Cnidaria | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 343.552
TPSA?: 69.56
MolLogP?: 4.325600000000002
Number of H-Donors: 3
Number of H-Acceptors: 3
RingCount: 0
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | HL-60 | Apoptosis | 13.0 | % | 10.1016/s0960-894x(02)01026-0 |
| Homo sapiens | SUP-T1 | IC50 | 200000.0 | nM | 10.1016/j.bmc.2009.01.005 |
| Klebsiella aerogenes | Klebsiella aerogenes | Activity | nan | None | 10.1021/np800362g |
| Mus musculus | FL5.12 | Activity | 0.0 | None | 10.1016/j.bmc.2016.07.038 |
| Mus musculus | FL5.12 | Activity | 13.0 | % | 10.1016/j.bmc.2016.07.038 |
| Mus musculus | FL5.12 | Activity | nan | None | 10.1016/j.bmc.2016.07.038 |
| Mus musculus | RAW264.7 | Activity | 46.9 | % | 10.1021/np800362g |
| Mus musculus | RAW264.7 | Activity | 77.2 | % | 10.1021/np800362g |
| Mus musculus | RAW264.7 | Activity | nan | None | 10.1021/np800362g |
| Salmonella enterica subsp. enterica | Salmonella enterica subsp. enterica | Activity | nan | None | 10.1021/np800362g |
| Serratia marcescens | Serratia marcescens | Activity | nan | None | 10.1021/np800362g |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Hit score | 0.1025 | None | 10.1101/2020.04.21.054387 |
| Shigella sonnei | Shigella sonnei | Activity | nan | None | 10.1021/np800362g |
| Yersinia enterocolitica | Yersinia enterocolitica | Activity | nan | None | 10.1021/np800362g |
| None | Unchecked | Inhibition | nan | % | 10.1038/nchembio873 |
