cyclo(phe-phe)
AlkaPlorer ID: AK015339
Synonym: 'cyclo(Phe-Phe)'
IUPAC Name: (3S,6S)-3,6-dibenzylpiperazine-2,5-dione
Structure
SMILES: O=C1N[C@@H](CC2=CC=CC=C2)C(=O)N[C@H]1CC1=CC=CC=C1
InChI: InChI=1S/C18H18N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)16(20-17)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,22)(H,20,21)/t15-,16-/m0/s1
InChIKey: JUAPMRSLDANLAS-HOTGVXAUSA-N
Reference
PubChem CID: 76116
CAS: 2862-51-3
LOTUS: LTS0193097
SuperNatural Ⅲ: SN0175229-01
NPASS: NPC311242
Source
Properties Information
Molecule Weight: 294.354
TPSA?: 58.2
MolLogP?: 1.4549999999999992
Number of H-Donors: 2
Number of H-Acceptors: 2
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Escherichia coli | Escherichia coli | MIC | 192.0 | ug.mL-1 | 10.1016/j.bmc.2018.11.042 |
| Fusobacterium nucleatum | Fusobacterium nucleatum | Inhibition | nan | % | 10.1016/j.bmc.2018.11.042 |
| Homo sapiens | A2780 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | A549 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | Bel-7402 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | BGC-823 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | Calpain 1 | Inhibition | 0.0 | % | 10.1016/j.bmcl.2005.04.031 |
| Homo sapiens | HCT-116 | Inhibition | nan | % | 10.1021/np1000895 |
| Homo sapiens | HCT-8 | Inhibition | nan | % | 10.1021/np1000895 |
| Limosilactobacillus fermentum | Limosilactobacillus fermentum | Inhibition | nan | % | 10.1016/j.bmc.2018.11.042 |
| Listeria monocytogenes | Listeria monocytogenes | MIC | 192.0 | ug.mL-1 | 10.1016/j.bmc.2018.11.042 |
| Mycobacterium tuberculosis | Cytochrome P450 | Activity | 0.0 | % | 10.1021/acs.jmedchem.9b01199 |
| Mycobacterium tuberculosis | Cytochrome P450 | Activity | 3.0 | % | 10.1021/acs.jmedchem.9b01199 |
| Mycobacterium tuberculosis | Cytochrome P450 | Kd | 2400.0 | nM | 10.1021/acs.jmedchem.9b01199 |
| Mycobacterium tuberculosis | Cytochrome P450 | Stability | nan | % | 10.1021/acs.jmedchem.9b01199 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | 100000.0 | nM | 10.1021/acs.jmedchem.9b01199 |
| Plasmodium berghei | Plasmodium berghei | Activity | 84.33 | % | 10.1016/j.bmcl.2012.09.094 |
| Plasmodium berghei | Plasmodium berghei | IC50 | 2540.0 | nM | 10.1016/j.bmcl.2012.09.094 |
| Porphyromonas gingivalis | Porphyromonas gingivalis | Inhibition | nan | % | 10.1016/j.bmc.2018.11.042 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 192.0 | ug.mL-1 | 10.1016/j.bmc.2018.11.042 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 192.0 | ug.mL-1 | 10.1016/j.bmc.2018.11.042 |
| Streptococcus mutans | Streptococcus mutans | GI | nan | None | 10.1016/j.bmc.2018.11.042 |
| Streptococcus mutans | Streptococcus mutans | Inhibition | nan | % | 10.1016/j.bmc.2018.11.042 |
| None | ADMET | Log Phep | 3.0 | None | 10.1021/jm00076a002 |
| None | No relevant target | LogP | 1.59 | None | 10.1021/jm00076a002 |
| None | No relevant target | LogP | 2.86 | None | 10.1021/jm00076a002 |
