Xanthosine
AlkaPlorer ID: AK015702
Synonym: None
IUPAC Name: 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione
Structure
SMILES: O=C1NC(=O)C2=C(N1)N([C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)C=N2
InChI: InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3-,5-,6-,9-/m1/s1
InChIKey: UBORTCNDUKBEOP-UUOKFMHZSA-N
Source
Properties Information
Molecule Weight: 284.228
TPSA?: 153.46000000000004
MolLogP?: -2.975599999999999
Number of H-Donors: 5
Number of H-Acceptors: 8
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus anthracis | Bacillus anthracis | Activity | nan | None | 10.1074/jbc.m611432200 |
| Bacillus anthracis | Bacillus anthracis | IC50 | 7190000.0 | nM | 10.1128/aac.01029-10 |
| Bacillus anthracis | Bacillus anthracis | IC50 | nan | None | 10.1128/aac.01029-10 |
| Bacillus anthracis | Bacillus anthracis | Ki | 777000.0 | nM | 10.1074/jbc.m611432200 |
| Mus musculus | J774.A1 | Activity | nan | None | 10.1128/aac.01029-10 |
| None | Erythroleukemia cell line | ID50 | 7.0 | mM | 10.1021/jm00148a018 |
| None | Erythroleukemia cell line | Optimal concentration | 7.0 | mM | 10.1021/jm00148a018 |
