Periglaucine C
AlkaPlorer ID: AK017134
Synonym: None
IUPAC Name: (1R,11R,13S,14S,15R)-14,15-dimethoxy-20-methyl-5,7,21-trioxa-20-azahexacyclo[11.4.3.111,14.01,13.02,10.04,8]henicosa-2,4(8),9-triene-16,19-dione
Structure
SMILES: CO[C@@H]1C(=O)C[C@]23CC(=O)N(C)[C@@]24C[C@@H](O[C@]14OC)C1=CC2=C(C=C13)OCO2
InChI: InChI=1S/C20H21NO7/c1-21-16(23)8-18-6-12(22)17(24-2)20(25-3)19(18,21)7-15(28-20)10-4-13-14(5-11(10)18)27-9-26-13/h4-5,15,17H,6-9H2,1-3H3/t15-,17-,18-,19+,20-/m1/s1
InChIKey: JCBUXRPOTHJGDK-RACLHMPKSA-N
Reference
Periglaucines A−D, Anti-HBV and -HIV-1 Alkaloids from <i>Pericampylus glaucus</i>
PubChem CID: 44577170
LOTUS: LTS0114177
NPASS: NPC475747
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Pericampylus glaucus | Pericampylus | Menispermaceae | Ranunculales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 387.3880000000002
TPSA?: 83.53000000000002
MolLogP?: 1.0595
Number of H-Donors: 0
Number of H-Acceptors: 7
RingCount: 6
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Hepatitis B virus | Hepatitis B virus | IC50 | 1720000.0 | nM | 10.1021/np070479+ |
| Hepatitis B virus | Hepatitis B virus | IC50 | 3690000.0 | nM | 10.1021/np070479+ |
| Homo sapiens | C8166 | CC50 | 516000.0 | nM | 10.1021/np070479+ |
| Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | 162500.0 | nM | 10.1021/np070479+ |
| None | ADMET | CC50 | 2360000.0 | nM | 10.1021/np070479+ |
| None | Unchecked | Ratio CC50/EC50 | 3.29 | None | 10.1021/np070479+ |
| None | Unchecked | Ratio CC50/IC50 | 1.0 | None | 10.1021/np070479+ |
| None | Unchecked | Ratio CC50/IC50 | 1.37 | None | 10.1021/np070479+ |
