Norpluvine
AlkaPlorer ID: AK017148
Synonym: None
IUPAC Name: (1S,15R,16S)-4-methoxy-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,12-tetraene-5,15-diol
Structure
SMILES: COC1=CC2=C(C=C1O)CN1CCC3=CC[C@@H](O)[C@@H]2[C@@H]31
InChI: InChI=1S/C16H19NO3/c1-20-14-7-11-10(6-13(14)19)8-17-5-4-9-2-3-12(18)15(11)16(9)17/h2,6-7,12,15-16,18-19H,3-5,8H2,1H3/t12-,15-,16-/m1/s1
InChIKey: KYCRETLRESMMIM-DAXOMENPSA-N
Reference
O-Methyloduline and N-demethylmasonine, alkaloids from Narcissus pseudonarcissus
PubChem CID: 12313583
LOTUS: LTS0028781
SuperNatural Ⅲ: SN0198553-02
NPASS: NPC249274
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Lycoris radiata | Lycoris | Amaryllidaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Orixa japonica | Orixa | Rutaceae | Sapindales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 273.33199999999994
TPSA?: 52.93000000000001
MolLogP?: 1.7633
Number of H-Donors: 2
Number of H-Acceptors: 4
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | A549 | IC50 | 10000.0 | nM | 10.1021/jm901031h |
| Homo sapiens | A549 | IC50 | 10000.0 | nM | 10.1021/np9008255 |
| Homo sapiens | SK-MEL | IC50 | 10000.0 | nM | 10.1021/np9008255 |
| Homo sapiens | SK-MEL-28 | IC50 | 10000.0 | nM | 10.1021/jm901031h |
| Mus musculus | B16-F10 | IC50 | 10000.0 | nM | 10.1021/jm901031h |
| Mus musculus | B16-F10 | IC50 | 10000.0 | nM | 10.1021/np9008255 |
| Trypanosoma brucei rhodesiense | Trypanosoma brucei rhodesiense | IC50 | 90.0 | ug.mL-1 | 10.1016/j.bmcl.2019.126642 |
| None | NON-PROTEIN TARGET | IC50 | 10000.0 | nM | 10.1021/jm901031h |
| None | NON-PROTEIN TARGET | IC50 | 10000.0 | nM | 10.1021/np9008255 |
