Taxiphyllin
AlkaPlorer ID: AK018084
Synonym: None
IUPAC Name: (2R)-2-(4-hydroxyphenyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetonitrile
Structure
SMILES: N#C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C1=CC=C(O)C=C1
InChI: InChI=1S/C14H17NO7/c15-5-9(7-1-3-8(17)4-2-7)21-14-13(20)12(19)11(18)10(6-16)22-14/h1-4,9-14,16-20H,6H2/t9-,10+,11+,12-,13+,14+/m0/s1
InChIKey: NVLTYOJHPBMILU-GMDXDWKASA-N
Reference
PubChem CID: 107721
CAS: 21401-21-8
LOTUS: LTS0209760
SuperNatural Ⅲ: SN0256366-05
NPASS: NPC212176
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Triglochin maritima | Triglochin | Juncaginaceae | Alismatales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | Salsola | Chenopodiaceae | Caryophyllales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 311.29
TPSA?: 143.4
MolLogP?: -1.22662
Number of H-Donors: 5
Number of H-Acceptors: 8
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Artemia salina | Artemia salina | ED50 | 0.96 | uM | 10.1021/np060222w |
| Escherichia coli | Escherichia coli | MBC | 700.0 | ug ml-1 | 10.1021/np060222w |
| Escherichia coli | Escherichia coli | MIC | 600.0 | ug.mL-1 | 10.1021/np060222w |
| Micrococcus luteus | Micrococcus luteus | MBC | 500.0 | ug ml-1 | 10.1021/np060222w |
| Micrococcus luteus | Micrococcus luteus | MIC | 200.0 | ug.mL-1 | 10.1021/np060222w |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MBC | nan | None | 10.1021/np060222w |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 700.0 | ug.mL-1 | 10.1021/np060222w |
| Staphylococcus aureus | Staphylococcus aureus | MBC | 700.0 | ug ml-1 | 10.1021/np060222w |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 400.0 | ug.mL-1 | 10.1021/np060222w |
| Staphylococcus epidermidis | Staphylococcus epidermidis | MBC | 700.0 | ug ml-1 | 10.1021/np060222w |
| Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | 500.0 | ug.mL-1 | 10.1021/np060222w |
