beta-Lumicolchicine
AlkaPlorer ID: AK018466
Synonym: '', 'gamma-Lumicolchicine'
IUPAC Name: N-[(10S,12R,16S)-3,4,5,14-tetramethoxy-13-oxo-10-tetracyclo[9.5.0.02,7.012,16]hexadeca-1(11),2,4,6,14-pentaenyl]acetamide
Structure
SMILES: COC1=C[C@@H]2C3=C([C@@H]2C1=O)[C@@H](N=C(C)O)CCC1=C3C(OC)=C(OC)C(OC)=C1
InChI: InChI=1S/C22H25NO6/c1-10(24)23-13-7-6-11-8-15(27-3)21(28-4)22(29-5)16(11)17-12-9-14(26-2)20(25)18(12)19(13)17/h8-9,12-13,18H,6-7H2,1-5H3,(H,23,24)/t12-,13+,18-/m1/s1
InChIKey: VKPVZFOUXUQJMW-FHSNZYRGSA-N
Reference
Robustamine ? A new homoproapophine base fromMerendera robusta
PubChem CID: 244898
CAS: 17071-62-4
LOTUS: LTS0274272
SuperNatural Ⅲ: SN0392840-02
NPASS: NPC3906
Source
Properties Information
Molecule Weight: 399.4430000000002
TPSA？: 86.58000000000001
MolLogP？: 3.116200000000002
Number of H-Donors: 1
Number of H-Acceptors: 6
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Artemia | Artemia | LC50 | 74.6 | ug.mL-1 | 10.1021/np0496587 |
| Aspergillus niger | Aspergillus niger | MIC | 500.0 | ug.mL-1 | 10.1021/np0496587 |
| Homo sapiens | Chromobox protein homolog 1 | Potency | 79432.8 | nM | None |
| Homo sapiens | Geminin | Potency | 326.4 | nM | None |
| Homo sapiens | MCF7 | EC50 | 1500.0 | nM | 10.1021/np0496587 |
| Homo sapiens | NCI-H460 | EC50 | 2100.0 | nM | 10.1021/np0496587 |
| Homo sapiens | SF-268 | EC50 | 3200.0 | nM | 10.1021/np0496587 |
| Micrococcus luteus | Micrococcus luteus | MIC | 500.0 | ug.mL-1 | 10.1021/np0496587 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | MIC | 500.0 | ug.mL-1 | 10.1021/np0496587 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 500.0 | ug.mL-1 | 10.1021/np0496587 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 19952.62 | nM | 10.6019/CHEMBL4651402 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | IC50 | 20000.0 | nM | 10.6019/CHEMBL4651402 |
| None | Unchecked | Activity | nan | None | 10.1021/acs.jnatprod.9b00880 |
| None | Unchecked | Potency | 92.0 | nM | None |