BMY-41219
AlkaPlorer ID: AK019518
Synonym: None
IUPAC Name: 3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione
Structure
SMILES: O=C1N=C(O)C2=C1C1=C(C3=C2C2=CC=CC=C2N3)N([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C2=CC=CC=C12
InChI: InChI=1S/C26H21N3O7/c30-9-14-21(31)22(32)23(33)26(36-14)29-13-8-4-2-6-11(13)16-18-17(24(34)28-25(18)35)15-10-5-1-3-7-12(10)27-19(15)20(16)29/h1-8,14,21-23,26-27,30-33H,9H2,(H,28,34,35)/t14-,21-,22+,23-,26-/m1/s1
InChIKey: FAKJOUAYZNXZGV-QCUUGYDUSA-N
Reference
Cytotoxic Indolocarbazoles from<i>Actinomadura melliaura</i>ATCC 39691
PubChem CID: 465911
NPASS: NPC107836
{NPAtlas: NPA005941
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Actinomadura | Thermomonosporaceae | Streptosporangiales | Actinomycetes | Actinomycetota | None | Bacteria |
| Actinomadura melliaura | Actinomadura | Thermomonosporaceae | Streptosporangiales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 487.4680000000002
TPSA?: 160.53
MolLogP?: 1.8597999999999992
Number of H-Donors: 6
Number of H-Acceptors: 7
RingCount: 7
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Escherichia coli | Escherichia coli | GI | nan | None | 10.1021/acs.jnatprod.5b00429 |
| Homo sapiens | A549 | Activity | 32.6 | % | 10.1021/acs.jnatprod.5b00429 |
| Homo sapiens | PC-3 | Activity | 47.7 | % | 10.1021/acs.jnatprod.5b00429 |
| Micrococcus luteus | Micrococcus luteus | GI | nan | None | 10.1021/acs.jnatprod.5b00429 |
| Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | GI | nan | None | 10.1021/acs.jnatprod.5b00429 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | GI | nan | None | 10.1021/acs.jnatprod.5b00429 |
| Salmonella enterica | Salmonella enterica | GI | nan | None | 10.1021/acs.jnatprod.5b00429 |
| Staphylococcus aureus | Staphylococcus aureus | GI | nan | None | 10.1021/acs.jnatprod.5b00429 |
| None | NON-PROTEIN TARGET | Activity | 53.6 | % | 10.1021/acs.jnatprod.5b00429 |
