Lynamicin F
AlkaPlorer ID: AK021215
Synonym: 'lynamicin F', 'Lynamicin F'
IUPAC Name: methyl 3,4-bis(5-chloro-1H-indol-3-yl)-1-methylpyrrole-2-carboxylate
Structure
SMILES: COC(=O)C1=C(C2=CNC3=CC=C(Cl)C=C23)C(C2=CNC3=CC=C(Cl)C=C23)=CN1C
InChI: InChI=1S/C23H17Cl2N3O2/c1-28-11-18(16-9-26-19-5-3-12(24)7-14(16)19)21(22(28)23(29)30-2)17-10-27-20-6-4-13(25)8-15(17)20/h3-11,26-27H,1-2H3
InChIKey: WTHPKNLNQHMHLV-UHFFFAOYSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | None | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 438.31400000000014
TPSA？: 62.81
MolLogP？: 6.415100000000003
Number of H-Donors: 2
Number of H-Acceptors: 3
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Bacillus thuringiensis | Bacillus thuringiensis | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Candida albicans | Candida albicans | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Escherichia coli | Escherichia coli | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Homo sapiens | HepG2 | Inhibition | nan | % | 10.1021/np500362p |
| Homo sapiens | MCF7 | IC50 | 10000.0 | nM | 10.1021/np500362p |
| Homo sapiens | NCI-H460 | Inhibition | nan | % | 10.1021/np500362p |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |