4a-dehydroxycrinamabine Trifluoroacetic acid
AlkaPlorer ID: AK022736
Synonym: '', '4a-Dehydroxycrinamabine', '(1beta,2beta)-Crinan-1,2-diol Trifluoroacetic acid'
IUPAC Name: (1S,13R,16R,17S)-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9-triene-16,17-diol
Structure
SMILES: O[C@@H]1CC[C@H]2N3CC[C@@]2(C2=CC4=C(C=C2C3)OCO4)[C@@H]1O
InChI: InChI=1S/C16H19NO4/c18-11-1-2-14-16(15(11)19)3-4-17(14)7-9-5-12-13(6-10(9)16)21-8-20-12/h5-6,11,14-15,18-19H,1-4,7-8H2/t11-,14-,15-,16+/m1/s1
InChIKey: DLYIURZCCWSUKD-MPESAESLSA-N
Reference
Augustamine type alkaloids from Crinum kirkii
PubChem CID: 399199
CAS: 151204-56-7
LOTUS: LTS0210317
SuperNatural Ⅲ: SN0069285-02
NPASS: NPC311991
Source
Properties Information
Molecule Weight: 289.331
TPSA？: 62.16000000000001
MolLogP？: 0.7565999999999999
Number of H-Donors: 2
Number of H-Acceptors: 5
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | A-431 | ED50 | 20.0 | ug ml-1 | 10.1021/np50098a017 |
| Homo sapiens | HT-1080 | ED50 | 20.0 | ug ml-1 | 10.1021/np50098a017 |
| Homo sapiens | KB | ED50 | 20.0 | ug ml-1 | 10.1021/np50098a017 |
| Homo sapiens | LNCaP | ED50 | 20.0 | ug ml-1 | 10.1021/np50098a017 |
| Homo sapiens | SK-MEL-2 | ED50 | 20.0 | ug ml-1 | 10.1021/np50098a017 |
| Homo sapiens | ZR-75-1 | ED50 | 20.0 | ug ml-1 | 10.1021/np50098a017 |
| Mus musculus | P388 | ED50 | 5.0 | ug ml-1 | 10.1021/np50098a017 |
| Plasmodium falciparum | Plasmodium falciparum | ED50 | 10000.0 | ug ml-1 | 10.1021/np50098a017 |
| Trypanosoma brucei rhodesiense | Trypanosoma brucei rhodesiense | IC50 | 31.9 | ug.mL-1 | 10.1016/j.bmcl.2019.126642 |
| None | NON-PROTEIN TARGET | ED50 | 20.0 | ug ml-1 | 10.1021/np50098a017 |