(2R,4S,5R,6S,7R)-4,5,6,11-tetrahydroxy-13,15-dioxa-8-azatetracyclo[8.7.0.0²,⁷.0¹²,¹⁶]heptadeca-1(10),11,16-trien-9-one
AlkaPlorer ID: AK022932
Synonym: None
IUPAC Name: (2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one
Structure
SMILES: OC1=N[C@H]2[C@H](O)[C@H](O)[C@@H](O)C[C@@H]2C2=CC3=C(OCO3)C(O)=C12
InChI: InChI=1S/C14H15NO7/c16-6-1-5-4-2-7-13(22-3-21-7)11(18)8(4)14(20)15-9(5)12(19)10(6)17/h2,5-6,9-10,12,16-19H,1,3H2,(H,15,20)/t5-,6+,9-,10-,12+/m1/s1
InChIKey: SBTGHBALOCEVOR-PUZXQUAOSA-N
Reference
Antineoplastic Agents, 162. Zephyranthes candida
PubChem CID: 101204
CAS: 40042-05-5
LOTUS: LTS0246761
SuperNatural Ⅲ: SN0341178-04
NPASS: NPC289743
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Zephyranthes candida | Zephyranthes | Amaryllidaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | Hymenocallis | Amaryllidaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | None | Amaryllidaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 309.274
TPSA？: 131.97000000000003
MolLogP？: -0.6223000000000005
Number of H-Donors: 5
Number of H-Acceptors: 7
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| dengue virus type 4 | dengue virus type 4 | IC50 | 0.015 | ug.mL-1 | 10.1021/np50089a003 |
| Escherichia coli | Escherichia coli | MIC | 4.0 | ug.mL-1 | 10.1016/j.bmcl.2017.09.052 |
| Homo sapiens | BXPC-3 | GI50 | 0.012 | ug.mL-1 | 10.1021/np0304518 |
| Homo sapiens | Cytochrome P450 19A1 | Inhibition | nan | % | 10.1021/np100657w |
| Homo sapiens | Cytochrome P450 1A1 | Inhibition | nan | % | 10.1021/np100657w |
| Homo sapiens | DU-145 | GI50 | 0.0066 | ug.mL-1 | 10.1021/np0304518 |
| Homo sapiens | KM-20L2 | GI50 | 0.015 | ug.mL-1 | 10.1021/np0304518 |
| Homo sapiens | MCF7 | GI50 | 0.0053 | ug.mL-1 | 10.1021/np0304518 |
| Homo sapiens | NCI-H460 | GI50 | 0.0092 | ug.mL-1 | 10.1021/np0304518 |
| Homo sapiens | SF-268 | GI50 | 0.02 | ug.mL-1 | 10.1021/np0304518 |
| Japanese encephalitis virus | Japanese encephalitis virus | IC50 | 0.004 | ug.mL-1 | 10.1021/np50089a003 |
| Mus musculus | P388 | ED50 | 0.0024 | ug ml-1 | 10.1021/np0304518 |
| Mus musculus | P388 | ED50 | 0.0032 | ug ml-1 | 10.1021/np50067a026 |
| Mus musculus | P388 | ED50 | 0.02 | ug ml-1 | 10.1021/np50100a004 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 16.0 | ug.mL-1 | 10.1016/j.bmcl.2017.09.052 |
| Punta Toro virus | Punta Toro virus | IC50 | 0.008 | ug.mL-1 | 10.1021/np50089a003 |
| Rift Valley fever virus | Rift Valley fever virus | IC50 | nan | None | 10.1021/np50089a003 |
| Sandfly fever Sicilian virus | Sandfly fever Sicilian virus | IC50 | nan | None | 10.1021/np50089a003 |
| Shigella flexneri | Shigella flexneri | MIC | 4.0 | ug.mL-1 | 10.1016/j.bmcl.2017.09.052 |
| Yellow fever virus | Yellow fever virus | IC50 | 0.003 | ug.mL-1 | 10.1021/np50089a003 |
| None | ADMET | TI | 3.3 | None | 10.1021/np50089a003 |
| None | ADMET | TI | 4.2 | None | 10.1021/np50089a003 |
| None | ADMET | TI | 5.6 | None | 10.1021/np50089a003 |
| None | ADMET | TI | 8.5 | None | 10.1021/np50089a003 |
| None | No relevant target | Solubility | 1000.0 | ug.mL-1 | 10.1021/np0304518 |