Leutinacin
AlkaPlorer ID: AK024083
Synonym: None
IUPAC Name: (2R,3R)-4-(6-aminopurin-9-yl)-2,3-dihydroxybutanoic acid
Structure
SMILES: NC1=NC=NC2=C1N=CN2C[C@@H](O)[C@@H](O)C(=O)O
InChI: InChI=1S/C9H11N5O4/c10-7-5-8(12-2-11-7)14(3-13-5)1-4(15)6(16)9(17)18/h2-4,6,15-16H,1H2,(H,17,18)(H2,10,11,12)/t4-,6-/m1/s1
InChIKey: LIEMBEWXEZJEEZ-INEUFUBQSA-N
Reference
Lentinacin: a new hypocholesterolemic substance inLentinus edodes
PubChem CID: 159961
LOTUS: LTS0260483
SuperNatural Ⅲ: SN0206152-04
{NPAtlas: NPA016035
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Lentinus | Polyporaceae | Polyporales | Agaricomycetes | Basidiomycota | Fungi | Eukaryota |
Properties Information
Molecule Weight: 253.218
TPSA？: 147.38
MolLogP？: -1.7851000000000008
Number of H-Donors: 4
Number of H-Acceptors: 8
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Acinetobacter baumannii | Acinetobacter baumannii | Inhibition | 10.49 | % | 10.6019/CHEMBL4513149 |
| Candida albicans | Candida albicans | Inhibition | 3.88 | % | 10.6019/CHEMBL4513149 |
| Cryptococcus neoformans | Cryptococcus neoformans | Inhibition | -6.54 | % | 10.6019/CHEMBL4513149 |
| Cryptosporidium parvum | Cryptosporidium parvum | Inhibition | nan | % | 10.6019/CHEMBL3832761 |
| Escherichia coli | Escherichia coli | Inhibition | 8.78 | % | 10.6019/CHEMBL4513149 |
| Homo sapiens | Ferrochelatase, mitochondrial | Inhibition | nan | % | 10.6019/CHEMBL3987221 |
| Homo sapiens | HepG2 | CC20 | 80.0 | uM | 10.6019/CHEMBL3832761 |
| Homo sapiens | Porphobilinogen deaminase | Inhibition | nan | % | 10.6019/CHEMBL3987221 |
| Klebsiella pneumoniae | Klebsiella pneumoniae | Inhibition | 17.23 | % | 10.6019/CHEMBL4513149 |
| Naegleria gruberi | Naegleria gruberi | Inhibition | 36.3 | % | 10.6019/CHEMBL4513101 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | 17.98 | % | 10.6019/CHEMBL4513149 |
| Rattus norvegicus | Adenosylhomocysteinase | IC50 | 30.0 | nM | 10.1016/j.bmc.2009.07.061 |
| Staphylococcus aureus | Staphylococcus aureus | Inhibition | 13.9 | % | 10.6019/CHEMBL4513149 |