Daphnandrine
AlkaPlorer ID: AK026124
Synonym: '(+)-Daphnandrine', 'Daphnandrine', "O12'-Methyldaphnoline"
IUPAC Name: (1R,14S)-6,20,25-trimethoxy-15-methyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaen-21-ol
Structure
SMILES: COC1=CC=C2C=C1OC1=CC=C(C=C1)C[C@H]1C3=C(C=C(OC)C(O)=C3OC3=C(OC)C=C4CCN[C@H](C2)C4=C3)CCN1C
InChI: InChI=1S/C36H38N2O6/c1-38-14-12-24-19-33(42-4)35(39)36-34(24)28(38)16-21-5-8-25(9-6-21)43-31-17-22(7-10-29(31)40-2)15-27-26-20-32(44-36)30(41-3)18-23(26)11-13-37-27/h5-10,17-20,27-28,37,39H,11-16H2,1-4H3/t27-,28+/m1/s1
InChIKey: REKCBEFSIKOPTD-IZLXSDGUSA-N
Reference
139. Alkaloids of Daphnandra species. Part IV. Observations on repanduline
PubChem CID: 442214
CAS: 1183-76-2
LOTUS: LTS0044178
SuperNatural Ⅲ: SN0323101-01
NPASS: NPC11296
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Stephania erecta | Stephania | Menispermaceae | Ranunculales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 594.7080000000001
TPSA？: 81.65
MolLogP？: 6.517200000000006
Number of H-Donors: 2
Number of H-Acceptors: 8
RingCount: 8
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | A-431 | ED50 | 8.3 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | HT-1080 | ED50 | 6.9 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | KB | ED50 | 5.8 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | LNCaP | ED50 | 5.8 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | SK-MEL-2 | ED50 | 13.4 | ug ml-1 | 10.1021/np50091a005 |
| Homo sapiens | ZR-75-1 | ED50 | 1.2 | ug ml-1 | 10.1021/np50091a005 |
| Mus musculus | P388 | ED50 | 2.0 | ug ml-1 | 10.1021/np50091a005 |
| Plasmodium falciparum | Plasmodium falciparum | ED50 | 63.0 | ng/ml | 10.1021/np50091a005 |
| Plasmodium falciparum | Plasmodium falciparum | ED50 | 223.2 | ng/ml | 10.1021/np50091a005 |
| None | ADMET | ED50 | 2.0 | ug ml-1 | 10.1021/np50091a005 |
| None | ADMET | ED50 | 2.2 | ug ml-1 | 10.1021/np50091a005 |
| None | ADMET | ED50 | 4.6 | ug ml-1 | 10.1021/np50091a005 |
| None | ADMET | ED50 | 10.3 | ug ml-1 | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 8.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 9.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 10.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 21.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 26.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 29.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 31.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 32.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 35.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 37.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 40.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 46.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 60.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 73.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 92.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 110.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 132.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 143.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 164.0 | None | 10.1021/np50091a005 |
| None | Unchecked | Ratio ED50 | 213.0 | None | 10.1021/np50091a005 |