(2R,3R,4R,5R)-2-(2-hydroxyethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol
AlkaPlorer ID: AK026535
Synonym: None
IUPAC Name: (2R,3R,4R,5R)-2-(2-hydroxyethyl)-5-(hydroxymethyl)pyrrolidine-3,4-diol
Structure
SMILES: OCC[C@H]1N[C@H](CO)[C@@H](O)[C@@H]1O
InChI: InChI=1S/C7H15NO4/c9-2-1-4-6(11)7(12)5(3-10)8-4/h4-12H,1-3H2/t4-,5-,6-,7-/m1/s1
InChIKey: AGFACLQFIYFFOI-DBRKOABJSA-N
Reference
Nitrogen-Containing Furanose and Pyranose Analogues from <i>Hyacinthus </i><i>orientalis</i>
PubChem CID: 10374978
LOTUS: LTS0069615
SuperNatural Ⅲ: SN0004790-02
NPASS: NPC116377
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | Scilla | Hyacinthaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Hyacinthus orientalis | Hyacinthus | Hyacinthaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 177.20000000000002
TPSA?: 92.95
MolLogP?: -2.5766999999999984
Number of H-Donors: 5
Number of H-Acceptors: 5
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bos taurus | Alpha-L-fucosidase 1 | Inhibition | 50.0 | % | 10.1021/np020296h |
| Bos taurus | Alpha-L-fucosidase 1 | Inhibition | 50.0 | % | 10.1021/np9705726 |
| Bos taurus | Beta-galactosidase | IC50 | 88000.0 | nM | 10.1021/np020296h |
| Caldicellulosiruptor saccharolyticus | Beta-glucosidase A | IC50 | 350000.0 | nM | 10.1021/np020296h |
| Homo sapiens | Glycogen debranching enzyme | IC50 | 11000.0 | nM | 10.1016/j.bmc.2008.01.032 |
| Rattus norvegicus | Acidic alpha-glucosidase | IC50 | 2500.0 | nM | 10.1021/np9705726 |
| Rattus norvegicus | Acidic alpha-glucosidase | IC50 | 7200.0 | nM | 10.1021/np9705726 |
| Rattus norvegicus | Acidic alpha-glucosidase | Inhibition | 50.0 | % | 10.1021/np020296h |
| Rattus norvegicus | Beta-mannosidase | IC50 | 320000.0 | nM | 10.1021/np020296h |
| Rattus norvegicus | Lactase-glycosylceramidase | IC50 | 320000.0 | nM | 10.1021/np9705726 |
| Rattus norvegicus | Sucrase-isomaltase | IC50 | 11000.0 | nM | 10.1021/np9705726 |
| Rattus norvegicus | Sucrase-isomaltase | Inhibition | 50.0 | % | 10.1021/np9705726 |
| Saccharomyces cerevisiae S288c | Oligo-1,6-glucosidase | IC50 | 250000.0 | nM | 10.1021/np020296h |
| Sus scrofa | Uncharacterized protein | Inhibition | 50.0 | % | 10.1021/np9705726 |
| None | Unchecked | IC50 | 2200.0 | nM | 10.1021/np9705726 |
| None | Unchecked | IC50 | 60000.0 | nM | 10.1021/np9705726 |
| None | Unchecked | IC50 | 94000.0 | nM | 10.1021/np020296h |
| None | Unchecked | IC50 | 380000.0 | nM | 10.1021/np9705726 |
| None | Unchecked | Inhibition | 50.0 | % | 10.1016/j.bmc.2008.01.032 |
| None | Unchecked | Inhibition | 50.0 | % | 10.1021/np020296h |
