Thiazomycin C
AlkaPlorer ID: AK028641
Synonym: None
IUPAC Name: 2-[(1S,18S,21E,28S,29S,30S)-30-[(2S,4S,5R,6S)-5-(dimethylamino)-4-hydroxy-4,6-dimethyloxan-2-yl]oxy-9-hydroxy-18-[(1R)-1-hydroxyethyl]-21-(1-methoxyethylidene)-16,19,26,31,42,46-hexaoxo-32,43,54-trioxa-3,13,23,49-tetrathia-7,17,20,27,45,51,52,55,56,57-decazadecacyclo[26.16.6.229,40.12,5.112,15.122,25.138,41.147,50.06,11.034,39]heptapentaconta-2(57),4,6,8,10,12(56),14,22(55),24,34(39),35,37,40,47,50-pentadecaen-8-yl]-1,3-thiazole-4-carboxamide
Structure
SMILES: CO/C(C)=C1/N=C(O)[C@H]([C@@H](C)O)N=C(O)C2=CSC(=N2)C2=C(N=C(C3=NC(C(=N)O)=CS3)C(O)=C2)C2=CSC(=N2)[C@@H]2COC(=O)C3=C4CO[C@H]([C@H](O[C@H]5C[C@](C)(O)[C@H](N(C)C)[C@H](C)O5)C(=O)OCC5=CC=CC(=C54)N3)[C@H](N=C(O)C3=CSC1=N3)C1=NC(=CS1)C(O)=N2
InChI: InChI=1S/C58H57N13O16S5/c1-21(72)37-50(78)69-38(22(2)82-7)53-65-33(20-91-53)49(77)70-42-43-44(87-35-12-58(4,81)45(71(5)6)23(3)86-35)57(80)84-13-24-9-8-10-27-36(24)26(14-83-43)40(60-27)56(79)85-15-28(61-47(75)31-19-92-55(42)66-31)52-62-29(16-89-52)39-25(51-64-32(18-88-51)48(76)68-37)11-34(73)41(67-39)54-63-30(17-90-54)46(59)74/h8-11,16-21,23,28,35,37,42-45,60,72-73,81H,12-15H2,1-7H3,(H2,59,74)(H,61,75)(H,68,76)(H,69,78)(H,70,77)/b38-22+/t21-,23+,28+,35+,37+,42+,43+,44+,45-,58+/m1/s1
InChIKey: HRIFYBRRXQXAKA-TUVVMWSLSA-N
Reference
Thiazomycins, Thiazolyl Peptide Antibiotics from <i>Amycolatopsis fastidiosa</i>
PubChem CID: 16154216
LOTUS: LTS0212175
NPASS: NPC115282
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 1352.504
TPSA?: 421.02
MolLogP?: 7.900070000000008
Number of H-Donors: 10
Number of H-Acceptors: 28
RingCount: 12
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Candida albicans | Candida albicans | MIC | 32.0 | ug.mL-1 | 10.1021/np800783b |
| Enterococcus faecalis | Enterococcus faecalis | MIC | 0.1 | ug.mL-1 | 10.1021/np800783b |
| Enterococcus faecalis | Enterococcus faecalis | MIC | 0.125 | ug.mL-1 | 10.1021/np040225d |
| Enterococcus faecium | Enterococcus faecium | MIC | 0.1 | ug.mL-1 | 10.1021/np800783b |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 0.03 | ug.mL-1 | 10.1021/np800783b |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 0.05 | ug.mL-1 | 10.1021/np800783b |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 0.06 | ug.mL-1 | 10.1021/np040225d |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 0.1 | ug.mL-1 | 10.1021/np800783b |
| Staphylococcus aureus | Staphylococcus aureus | PD50 | 4.35 | mg kg-1 | 10.1021/np040225d |
| Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | 0.1 | ug.mL-1 | 10.1021/np800783b |
| Staphylococcus haemolyticus | Staphylococcus haemolyticus | MIC | 0.1 | ug.mL-1 | 10.1021/np800783b |
| Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | 0.006 | ug.mL-1 | 10.1021/np800783b |
| Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | 0.01 | ug.mL-1 | 10.1021/np800783b |
| Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | 0.03 | ug.mL-1 | 10.1021/np040225d |
| Streptococcus pyogenes | Streptococcus pyogenes | MIC | 0.006 | ug.mL-1 | 10.1021/np800783b |
