312322-94-4
AlkaPlorer ID: AK029203
Synonym: '', 'Miraziridine A'
IUPAC Name: (2R,3R)-3-[[(2S)-1-[[(3S,4S)-1-[[(2S)-1-[[(E,3S)-1-carboxy-6-(diaminomethylideneamino)hex-1-en-3-yl]amino]-1-oxobutan-2-yl]amino]-3-hydroxy-6-methyl-1-oxoheptan-4-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]aziridine-2-carboxylic acid
Structure
SMILES: CC[C@H](N=C(O)C[C@H](O)[C@H](CC(C)C)N=C(O)[C@H](CC(C)C)N=C(O)[C@@H]1N[C@H]1C(=O)O)C(O)=N[C@H](/C=C/C(=O)O)CCCNC(=N)N
InChI: InChI=1S/C30H52N8O9/c1-6-18(26(43)34-17(9-10-23(41)42)8-7-11-33-30(31)32)35-22(40)14-21(39)19(12-15(2)3)36-27(44)20(13-16(4)5)37-28(45)24-25(38-24)29(46)47/h9-10,15-21,24-25,38-39H,6-8,11-14H2,1-5H3,(H,34,43)(H,35,40)(H,36,44)(H,37,45)(H,41,42)(H,46,47)(H4,31,32,33)/b10-9+/t17-,18-,19-,20-,21-,24+,25+/m0/s1
InChIKey: RCCNRKCJJRWUBV-KTIUQXCVSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Theonella mirabilis | Theonella | Theonellidae | Tetractinellida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 668.7929999999999
TPSA?: 309.03
MolLogP?: 1.869070000000008
Number of H-Donors: 11
Number of H-Acceptors: 9
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | Cathepsin B | Affinity | 15000.0 | M-1 s-1 | 10.1016/j.bmcl.2003.12.030 |
| Homo sapiens | Cathepsin B | IC50 | 1.4 | ug.mL-1 | 10.1016/j.ejmech.2009.05.013 |
| Homo sapiens | Cathepsin B | INH | 1.5 | 10'4/M/s | 10.1016/j.ejmech.2009.05.013 |
| Homo sapiens | Cathepsin L | Affinity | 1000000.0 | M-1 s-1 | 10.1016/j.bmcl.2003.12.030 |
| Homo sapiens | Cathepsin L | INH | 1.0 | 10'6/M/s | 10.1016/j.ejmech.2009.05.013 |
| Homo sapiens | Trypsin I | Affinity | 6e-05 | M | 10.1016/j.bmcl.2003.12.030 |
| Sus scrofa | Pepsin A | Affinity | 1.4e-08 | M | 10.1016/j.bmcl.2003.12.030 |
| Sus scrofa | Pepsin A | Ki | 14.0 | nM | 10.1016/j.bmcl.2003.12.030 |
| None | Unchecked | INH | 1.4 | 10'-8M | 10.1016/j.ejmech.2009.05.013 |
| None | Unchecked | INH | 6.0 | 10'-5M | 10.1016/j.ejmech.2009.05.013 |
