8'-epi-herbicidin B
AlkaPlorer ID: AK030248
Synonym: None
IUPAC Name: methyl (1S,3S,4R,5R,7R,9R,11S,12S,13R)-5-(6-aminopurin-9-yl)-1,12,13-trihydroxy-4-methoxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11-carboxylate
Structure
SMILES: COC(=O)[C@H]1O[C@@H]2C[C@H]3O[C@@H](N4C=NC5=C(N)N=CN=C54)[C@H](OC)[C@H]3O[C@@]2(O)[C@H](O)[C@@H]1O
InChI: InChI=1S/C18H23N5O9/c1-28-12-10-6(30-16(12)23-5-22-8-14(19)20-4-21-15(8)23)3-7-18(27,32-10)13(25)9(24)11(31-7)17(26)29-2/h4-7,9-13,16,24-25,27H,3H2,1-2H3,(H2,19,20,21)/t6-,7-,9-,10+,11+,12-,13-,16-,18-/m1/s1
InChIKey: GZBSICLBZYSADI-ZKKAIADESA-N
Reference
Herbicidin Congeners, Undecose Nucleosides from an Organic Extract of <i>Streptomyces</i> sp. L-9-10
PubChem CID: 76313958
LOTUS: LTS0225777
NPASS: NPC282458
{NPAtlas: NPA013561
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Streptomyces sp. CB01388 | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
| Streptomyces sp. L-9-10 | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 453.4080000000001
TPSA?: 193.53
MolLogP?: -2.5393999999999965
Number of H-Donors: 4
Number of H-Acceptors: 14
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Cryptosporidium parvum | Cryptosporidium parvum | EC50 | 25000.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | HCT-8 | EC50 | 25000.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | HEK293 | IC50 | 43700.0 | nM | 10.1021/np4006635 |
| Homo sapiens | HEK-293T | CC50 | 40000.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | HepG2 | CC50 | 40000.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | MCF7 | Activity | nan | None | 10.1021/np4006635 |
| Homo sapiens | Nitric oxide synthase, inducible | Inhibition | nan | % | 10.1021/np4006635 |
| Streptomyces | Streptomyces | Activity | nan | None | 10.1021/np4006635 |
| None | Radical scavenging activity | Activity | nan | None | 10.1021/np4006635 |
| None | Unchecked | IC50 | 3200.0 | nM | 10.1021/np4006635 |
| None | Unchecked | Inhibition | 53.0 | % | 10.1021/np4006635 |
| None | Unchecked | Inhibition | 92.2 | % | 10.1021/np4006635 |
