(1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.1¹⁰,¹⁴.0³,⁵]hexacosa-10,12,14(26),16,18-pentaen-6-yl (2S)-2-(N,2-dimethylpropanamido)propanoate
AlkaPlorer ID: AK030887
Synonym: None
IUPAC Name: [(1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaen-6-yl] (2S)-2-[methyl(2-methylpropanoyl)amino]propanoate
Structure
SMILES: COC1=C(Cl)C2=CC(=C1)C/C(C)=C/C=C/[C@@H](OC)[C@@]1(O)C[C@H](OC(O)=N1)[C@@H](C)[C@@H]1O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(=O)C(C)C)CC(=O)N2C
InChI: InChI=1S/C36H50ClN3O10/c1-19(2)32(42)39(7)22(5)33(43)49-28-17-29(41)40(8)24-15-23(16-25(46-9)30(24)37)14-20(3)12-11-13-27(47-10)36(45)18-26(48-34(44)38-36)21(4)31-35(28,6)50-31/h11-13,15-16,19,21-22,26-28,31,45H,14,17-18H2,1-10H3,(H,38,44)/b13-11+,20-12+/t21-,22+,26+,27-,28+,31+,35+,36+/m1/s1
InChIKey: RJIVUFYDGYNSNE-IZKDVACGSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Colubrina texensis | Colubrina | Rhamnaceae | Rosales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 720.26
TPSA?: 159.96
MolLogP?: 4.374900000000004
Number of H-Donors: 2
Number of H-Acceptors: 10
RingCount: 4
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | KB | ED50 | 3.6e-06 | ug ml-1 | 10.1021/jm00199a006 |
| Homo sapiens | Tubulin | Inhibition | nan | % | 10.1021/jm00199a006 |
| Mus musculus | Mus musculus | Activity | -1.3 | g | 10.1021/jm00199a006 |
| Mus musculus | Mus musculus | Activity | -0.9 | g | 10.1021/jm00199a006 |
| Mus musculus | Mus musculus | Activity | 0.0 | g | 10.1021/jm00199a006 |
| Mus musculus | Mus musculus | Activity | 0.1 | g | 10.1021/jm00199a006 |
| Mus musculus | Mus musculus | Activity | 0.3 | g | 10.1021/jm00199a006 |
| Mus musculus | Mus musculus | Activity | 0.4 | g | 10.1021/jm00199a006 |
| Mus musculus | Mus musculus | Activity | nan | None | 10.1021/jm00199a006 |
| Mus musculus | P388 | T/C | 80.0 | % | 10.1021/jm00199a006 |
| Mus musculus | P388 | T/C | 120.0 | % | 10.1021/jm00199a006 |
| Mus musculus | P388 | T/C | 125.0 | % | 10.1021/jm00199a006 |
| Mus musculus | P388 | T/C | 145.0 | % | 10.1021/jm00199a006 |
| Mus musculus | P388 | T/C | 155.0 | % | 10.1021/jm00199a006 |
| Mus musculus | P388 | T/C | 165.0 | % | 10.1021/jm00199a006 |
| Mus musculus | P388 | T/C | 190.0 | % | 10.1021/jm00199a006 |
| None | NON-PROTEIN TARGET | Activity | 1.0 | nM | 10.1021/jm00199a006 |
