Baraphenazine D
AlkaPlorer ID: AK030945
Synonym: 'Baraphenazine D'
IUPAC Name: (1S,16S,28R)-20,28-dihydroxy-4,11,18,25-tetrazaheptacyclo[14.11.1.02,15.03,12.05,10.017,26.019,24]octacosa-2(15),3,5,7,9,11,13,17,19(24),20,22,25-dodecaene-9-carboxylic acid
Structure
SMILES: O=C(O)C1=CC=CC2=NC3=C4C(=CC=C3N=C12)[C@H]1C2=NC3=C(O)C=CC=C3N=C2C[C@@H]4[C@H]1O
InChI: InChI=1S/C25H16N4O4/c30-17-6-2-5-14-21(17)29-23-16(26-14)9-12-18-10(19(23)24(12)31)7-8-15-22(18)28-13-4-1-3-11(25(32)33)20(13)27-15/h1-8,12,19,24,30-31H,9H2,(H,32,33)/t12-,19-,24+/m0/s1
InChIKey: JPMKFWGOMOITLB-OCPCCLDUSA-N
Reference
Baraphenazines A–G, Divergent Fused Phenazine-Based Metabolites from a Himalayan <i>Streptomyces</i>
PubChem CID: 145721015
LOTUS: LTS0153139
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | None | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 436.4270000000001
TPSA？: 129.32
MolLogP？: 3.2761000000000027
Number of H-Donors: 3
Number of H-Acceptors: 7
RingCount: 7
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Ambystoma mexicanum | Ambystoma mexicanum | Activity | nan | None | 10.1021/acs.jnatprod.9b00289 |
| Bacillus subtilis | Bacillus subtilis | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Escherichia coli | Escherichia coli | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Homo sapiens | A549 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Homo sapiens | PC-3 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Micrococcus luteus | Micrococcus luteus | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Mycolicibacterium aurum | Mycolicibacterium aurum | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Salmonella enterica | Salmonella enterica | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |