Lynamicin G
AlkaPlorer ID: AK031305
Synonym: 'lynamicin G', 'Lynamicin G'
IUPAC Name: dimethyl 3,4-bis(5-chloro-1H-indol-3-yl)-1-methylpyrrole-2,5-dicarboxylate
Structure
SMILES: COC(=O)C1=C(C2=CNC3=CC=C(Cl)C=C23)C(C2=CNC3=CC=C(Cl)C=C23)=C(C(=O)OC)N1C
InChI: InChI=1S/C25H19Cl2N3O4/c1-30-22(24(31)33-2)20(16-10-28-18-6-4-12(26)8-14(16)18)21(23(30)25(32)34-3)17-11-29-19-7-5-13(27)9-15(17)19/h4-11,28-29H,1-3H3
InChIKey: HDSWTZRUKHSYDF-UHFFFAOYSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | None | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 496.35000000000025
TPSA？: 89.11000000000001
MolLogP？: 6.201700000000004
Number of H-Donors: 2
Number of H-Acceptors: 5
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Bacillus thuringiensis | Bacillus thuringiensis | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Candida albicans | Candida albicans | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Escherichia coli | Escherichia coli | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |
| Homo sapiens | HepG2 | Inhibition | nan | % | 10.1021/np500362p |
| Homo sapiens | MCF7 | IC50 | 10000.0 | nM | 10.1021/np500362p |
| Homo sapiens | NCI-H460 | Inhibition | nan | % | 10.1021/np500362p |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 128.0 | ug.mL-1 | 10.1021/np500362p |