Cyclo(D-Tyr- L-Leu)
AlkaPlorer ID: AK031853
Synonym: 'Cyclo(D-Tyr- L-Leu)'
IUPAC Name: (3S,6S)-3-[(4-hydroxyphenyl)methyl]-6-(2-methylpropyl)piperazine-2,5-dione
Structure
SMILES: CC(C)C[C@@H]1N=C(O)[C@H](CC2=CC=C(O)C=C2)N=C1O
InChI: InChI=1S/C15H20N2O3/c1-9(2)7-12-14(19)17-13(15(20)16-12)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8H2,1-2H3,(H,16,20)(H,17,19)/t12-,13-/m0/s1
InChIKey: GENSLUDVKWKQMX-STQMWFEESA-N
Reference
Cyclic Peptides from an Endophytic Fungus Obtained from a Mangrove Leaf (<i>Kandelia candel</i>)
PubChem CID: 15550385
LOTUS: LTS0032096
SuperNatural Ⅲ: SN0103579-04
NPASS: NPC118202
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Panax notoginseng | Panax | Araliaceae | Apiales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| Callyspongia sp. | Callyspongia | Callyspongiidae | Haplosclerida | Demospongiae | Porifera | Metazoa | Eukaryota |
Properties Information
Molecule Weight: 276.336
TPSA？: 85.41000000000001
MolLogP？: 2.6446000000000005
Number of H-Donors: 3
Number of H-Acceptors: 3
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Homo sapiens | Calpain 1 | Inhibition | 0.0 | % | 10.1016/j.bmcl.2005.04.031 |
| Mus musculus | J774.A1 | Activity | 88.3 | % | 10.1016/j.bmcl.2012.03.045 |
| Mus musculus | J774.A1 | Activity | nan | None | 10.1016/j.bmcl.2012.03.045 |
| Mus musculus | J774.A1 | FC | 1.82 | None | 10.1016/j.bmcl.2012.03.045 |
| Mus musculus | J774.A1 | FC | 2.24 | None | 10.1016/j.bmcl.2012.03.045 |
| Staphylococcus epidermidis | Staphylococcus epidermidis | Activity | nan | None | 10.1016/j.bmcl.2012.12.020 |
| Staphylococcus epidermidis | Staphylococcus epidermidis | Inhibition | 60.0 | % | 10.1016/j.bmcl.2012.12.020 |
| Staphylococcus epidermidis | Staphylococcus epidermidis | Inhibition | 65.0 | % | 10.1016/j.bmcl.2012.12.020 |
| Staphylococcus epidermidis | Staphylococcus epidermidis | Inhibition | 85.0 | % | 10.1016/j.bmcl.2012.12.020 |
| Staphylococcus epidermidis | Staphylococcus epidermidis | Inhibition | nan | % | 10.1016/j.bmcl.2012.12.020 |