Sophenazine A
AlkaPlorer ID: AK033883
Synonym: None
IUPAC Name: bis[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1,6-dicarboxylate
Structure
SMILES: C[C@@H]1O[C@@H](OC(=O)C2=CC=CC3=NC4=C(C=CC=C4C(=O)O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)N=C23)[C@H](O)[C@H](O)[C@H]1O
InChI: InChI=1S/C26H28N2O12/c1-9-17(29)19(31)21(33)25(37-9)39-23(35)11-5-3-7-13-15(11)27-14-8-4-6-12(16(14)28-13)24(36)40-26-22(34)20(32)18(30)10(2)38-26/h3-10,17-22,25-26,29-34H,1-2H3/t9-,10-,17-,18-,19+,20+,21+,22+,25-,26-/m0/s1
InChIKey: JDJDBXTXLCFSLK-KZHZETPVSA-N
Reference
Solphenazines A–F, Glycosylated Phenazines from <i>Streptomyces</i> sp. Strain DL-93
PubChem CID: 71524366
LOTUS: LTS0238582
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | None | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 560.5120000000004
TPSA？: 218.22
MolLogP？: -1.2484000000000002
Number of H-Donors: 6
Number of H-Acceptors: 14
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Acinetobacter baumannii | Acinetobacter baumannii | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Bacillus spizizenii | Bacillus spizizenii | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Bos taurus | Topoisomerase I | Inhibition | nan | % | 10.1021/np3007606 |
| Candida albicans | Candida albicans | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Chlorocebus sabaeus | Vero | EC50 | 84000.0 | nM | 10.1021/np3007606 |
| Cryptococcus neoformans | Cryptococcus neoformans | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Enterococcus faecalis | Enterococcus faecalis | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Escherichia coli | Escherichia coli | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Homo sapiens | DNA topoisomerase I | Inhibition | nan | % | 10.1021/np3007606 |
| Homo sapiens | DNA topoisomerase II alpha | Inhibition | nan | % | 10.1021/np3007606 |
| Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 25.0 | ug.mL-1 | 10.1021/np3007606 |
| Streptomyces scabiei | Streptomyces scabiei | Activity | nan | None | 10.1021/np3007606 |
| None | NON-PROTEIN TARGET | EC50 | 18000.0 | nM | 10.1021/np3007606 |
| None | Unchecked | Inhibition | nan | % | 10.1021/np3007606 |