Baraphenazine G
AlkaPlorer ID: AK037030
Synonym: 'Baraphenazine G'
IUPAC Name: (1R,17R)-9,17,21-trihydroxy-16-oxa-4,11,19,26-tetrazaheptacyclo[15.11.1.02,15.03,12.05,10.018,27.020,25]nonacosa-2(15),3,5(10),6,8,11,13,18,20(25),21,23,26-dodecaene-13-carboxylic acid
Structure
SMILES: O=C(O)C1=CC2=C(C3=NC4=CC=CC(O)=C4N=C13)[C@@H]1CC3=NC4=CC=CC(O)=C4N=C3[C@@](O)(C1)O2
InChI: InChI=1S/C25H16N4O6/c30-15-5-2-4-13-20(15)28-19-11(24(32)33)8-17-18(22(19)27-13)10-7-14-23(25(34,9-10)35-17)29-21-12(26-14)3-1-6-16(21)31/h1-6,8,10,30-31,34H,7,9H2,(H,32,33)/t10-,25-/m1/s1
InChIKey: IKZAYRLYTAVSAG-REFGNXHDSA-N
Reference
Baraphenazines A–G, Divergent Fused Phenazine-Based Metabolites from a Himalayan <i>Streptomyces</i>
PubChem CID: 145721018
LOTUS: LTS0030185
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| None | None | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 468.4250000000003
TPSA?: 158.77999999999997
MolLogP?: 3.103100000000003
Number of H-Donors: 4
Number of H-Acceptors: 9
RingCount: 7
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Ambystoma mexicanum | Ambystoma mexicanum | Activity | nan | None | 10.1021/acs.jnatprod.9b00289 |
| Bacillus subtilis | Bacillus subtilis | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Escherichia coli | Escherichia coli | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Homo sapiens | A549 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Homo sapiens | PC-3 | IC50 | 50000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Micrococcus luteus | Micrococcus luteus | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Mycolicibacterium aurum | Mycolicibacterium aurum | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Salmonella enterica | Salmonella enterica | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
| Staphylococcus aureus | Staphylococcus aureus | MIC | 120000.0 | nM | 10.1021/acs.jnatprod.9b00289 |
