Enkephalin L
AlkaPlorer ID: AK038128
Synonym: 'Leucine enkephalin', 'leuenkephalin', 'Leu 5enkephalin', 'Leu5-Enkephalin', '5-LeucineEnkephalin', '58822-25-6'
IUPAC Name: (2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid
Structure
SMILES: CC(C)C[C@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)CNC(=O)CNC(=O)[C@@H](N)CC1=CC=C(O)C=C1)C(=O)O
InChI: InChI=1S/C28H37N5O7/c1-17(2)12-23(28(39)40)33-27(38)22(14-18-6-4-3-5-7-18)32-25(36)16-30-24(35)15-31-26(37)21(29)13-19-8-10-20(34)11-9-19/h3-11,17,21-23,34H,12-16,29H2,1-2H3,(H,30,35)(H,31,37)(H,32,36)(H,33,38)(H,39,40)/t21-,22-,23-/m0/s1
InChIKey: URLZCHNOLZSCCA-VABKMULXSA-N
Reference
Isolation of molluscan opioid peptides
PubChem CID: 124081685
CAS: 58822-25-6
LOTUS: LTS0273127
NPASS: NPC326966
Source
Properties Information
Molecule Weight: 555.6320000000004
TPSA？: 199.95
MolLogP？: -0.1625999999999939
Number of H-Donors: 7
Number of H-Acceptors: 7
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Cavia porcellus | Cavia porcellus | Activity | 24.0 | % | 10.1021/jm00177a016 |
| Cavia porcellus | Cavia porcellus | IC50 | 213.0 | nM | 10.1021/jm00394a010 |
| Cavia porcellus | Cavia porcellus | IC50 | 246.0 | nM | 10.1016/s0960-894x(00)00660-0 |
| Cavia porcellus | Cavia porcellus | IC50 | 246.0 | nM | 10.1021/jm00034a011 |
| Cavia porcellus | Cavia porcellus | IC50 | 246.0 | nM | 10.1021/jm00100a026 |
| Cavia porcellus | Cavia porcellus | IC50 | 246.0 | nM | 10.1021/jm00122a005 |
| Cavia porcellus | Cavia porcellus | IC50 | 246.0 | nM | 10.1021/jm00123a035 |
| Cavia porcellus | Cavia porcellus | IC50 | 246.0 | nM | 10.1021/jm00150a005 |
| Cavia porcellus | Cavia porcellus | Ke | 1.53 | nM | 10.1021/jm00123a035 |
| Cavia porcellus | Cavia porcellus | Ke | 1.53 | nM | 10.1021/jm00150a005 |
| Cavia porcellus | Cavia porcellus | Ke | 1.53 | nM | 10.1021/jm00394a010 |
| Cavia porcellus | Cavia porcellus | Relative potency | 1.0 | None | 10.1021/jm00100a026 |
| Cavia porcellus | Cavia porcellus | Relative potency | 1.0 | None | 10.1021/jm00123a035 |
| Cavia porcellus | Kappa opioid receptor | Ki | 4570.0 | nM | 10.1021/jm9019068 |
| Cavia porcellus | Kappa opioid receptor | Ki | 10000.0 | nM | 10.1021/jm00157a018 |
| Cavia porcellus | Mu opioid receptor | IC50 | 103.0 | nM | 10.1016/s0960-894x(00)00665-x |
| Cavia porcellus | Mu opioid receptor | IC50 | 246.0 | nM | 10.1021/acs.jmedchem.6b01200 |
| Cavia porcellus | Mu opioid receptor | IC50 | 246.0 | nM | 10.1021/jm00099a025 |
| Cavia porcellus | Mu opioid receptor | IC50 | 246.0 | nM | 10.1021/jm00354a008 |
| Cavia porcellus | Mu opioid receptor | IC50 | 246.0 | nM | 10.1021/jm4008592 |
| Cavia porcellus | Mu opioid receptor | IC50 | 246.0 | nM | 10.1021/jm9019068 |
| Cavia porcellus | Mu opioid receptor | Ke | 1.53 | nM | 10.1021/jm00354a008 |
| Cavia porcellus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm00394a010 |
| Cavia porcellus | Mu opioid receptor | Ki | 380.0 | nM | 10.1021/jm00157a018 |
| Cavia porcellus | Mu opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00034a011 |
| Cavia porcellus | Mu opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00099a025 |
| Danio rerio | Mu opioid receptor-like OR2 | Ki | 1317.0 | nM | 10.1016/j.bmc.2017.02.052 |
| Danio rerio | Opioid receptor, delta 1b | Ki | 175.0 | nM | 10.1016/j.bmc.2017.02.052 |
| Danio rerio | Opioid receptor homologue | Ki | 73.0 | nM | 10.1016/j.bmc.2017.02.052 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Inhib (Mean) | -18.11 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Adhesion G-protein coupled receptor F1 | %Max (Mean) | 10.52 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Inhib (Mean) | 8.0 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Alpha-2a adrenergic receptor | %Max (Mean) | 4.8 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Aminopeptidase N | T1/2 | 0.0115 | hr | 10.1016/j.bmcl.2019.07.033 |
| Homo sapiens | Aminopeptidase N | T1/2 | 0.0115 | hr | 10.1021/acs.jmedchem.0c00530 |
| Homo sapiens | Angiotensin-converting enzyme | T1/2 | 2.167 | hr | 10.1016/j.bmcl.2019.07.033 |
| Homo sapiens | Apelin receptor | %Inhib (Mean) | -2.87 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Apelin receptor | %Max (Mean) | -2.987 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Inhib (Mean) | -0.41 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Beta-2 adrenergic receptor | %Max (Mean) | -2.53 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Bromodomain-containing protein 4 | Delta TM | -1.09 | C | None |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Inhib (Mean) | -15.51 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C5a anaphylatoxin chemotactic receptor | %Max (Mean) | -4.451 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Caco-2 | Papp | 3.1 | 10'-7 cm/s | 10.1016/j.bmc.2010.12.042 |
| Homo sapiens | Casein kinase I delta | Delta TM | -0.01222 | C | None |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Inhib (Mean) | -17.78 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | C-X3-C chemokine receptor 1 | %Max (Mean) | -0.3693 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Cyclin-dependent kinase 2 | Delta TM | -0.1127 | C | None |
| Homo sapiens | Delta opioid receptor | Activity | nan | None | 10.1021/acs.jmedchem.2c01061 |
| Homo sapiens | Delta opioid receptor | EC50 | 0.08 | nM | 10.1016/j.bmcl.2019.07.033 |
| Homo sapiens | Delta opioid receptor | EC50 | 0.08 | nM | 10.1021/acs.jmedchem.0c00530 |
| Homo sapiens | Delta opioid receptor | EC50 | 1.0 | nM | 10.1021/acs.jmedchem.2c01061 |
| Homo sapiens | Delta opioid receptor | EC50 | 10.2 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Delta opioid receptor | EC50 | 10.23 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Delta opioid receptor | EC50 | 12.59 | nM | 10.1021/acs.jnatprod.0c01036 |
| Homo sapiens | Delta opioid receptor | EC50 | 42.66 | nM | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Delta opioid receptor | EC50 | 120.23 | nM | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Delta opioid receptor | Emax | 100.0 | % | 10.1039/D1MD00025J |
| Homo sapiens | Delta opioid receptor | Ki | 0.7 | nM | 10.1021/jm020125+ |
| Homo sapiens | Delta opioid receptor | Ki | 1.12 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Delta opioid receptor | Ki | 1.122 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Delta opioid receptor | Ki | 1.2 | nM | 10.1021/acs.jnatprod.0c01036 |
| Homo sapiens | Delta opioid receptor | Ki | 1.259 | nM | 10.1021/acs.jnatprod.0c01036 |
| Homo sapiens | Delta opioid receptor | Ki | 2.53 | nM | 10.1016/s0960-894x(00)00660-0 |
| Homo sapiens | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm00394a010 |
| Homo sapiens | Delta opioid receptor | Ki | 6.0 | nM | 10.1021/jm00157a018 |
| Homo sapiens | Delta opioid receptor | Ki | 6.9 | nM | 10.1016/j.bmcl.2019.07.033 |
| Homo sapiens | Delta opioid receptor | Ki | 6.9 | nM | 10.1021/acs.jmedchem.7b01788 |
| Homo sapiens | Delta opioid receptor | Ki | 31.0 | nM | 10.1016/s0960-894x(02)00678-9 |
| Homo sapiens | Delta opioid receptor | log(activity) | 0.25 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | log(activity) | 0.28 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | log(activity) | 0.94 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | log(activity) | 2.8 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | pKA | 6.6 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | pKA | 6.7 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | pKA | 7.9 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | pKA | 9.13 | None | 10.1021/acs.jmedchem.5b00007 |
| Homo sapiens | Delta opioid receptor | Ratio | 1.0 | None | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Delta opioid receptor | Selectivity ratio | 0.0 | None | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Apoptotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Fragmented Nuclei % | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Growth Rate | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 75.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Membrane Permeable-Phenotype Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitochondria Different-Phenotype Cells (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Pyknosed Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 101.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 106.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 107.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 108.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 110.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Total Cells | 125.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Control DMSO Tubulin Phenotype Different Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Apoptotic (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Fragmented Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 59.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Hoechst High Intensity Objects (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Membrane Permeable-Phenotype (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitochondria Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Mitotic Cells (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Pyknosed Nuclei (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 30.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Population Tubulin-Different-Phenotype (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 62.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 68.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 70.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 78.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 81.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 86.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 95.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 96.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 111.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 114.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 118.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 129.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 130.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast | Total Cell Count | 133.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Fibroblast growth factor receptor 3 | Delta TM | 0.00436 | C | None |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Inhib (Mean) | -34.58 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucagon-like peptide 1 receptor | %Max (Mean) | -0.14 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Inhib (Mean) | 14.46 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glucose-dependent insulinotropic receptor | %Max (Mean) | -2.503 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Glycogen synthase kinase-3 beta | Delta TM | -0.3615 | C | None |
| Homo sapiens | G-protein coupled receptor 120 | %Inhib (Mean) | -36.4 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 120 | %Max (Mean) | -1.5 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 35 | %Inhib (Mean) | -21.98 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | G-protein coupled receptor 35 | %Max (Mean) | 18.15 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Apoptotic Cells (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Fragmented Nuclei % | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 24.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 42.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Membrane Permeable-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitochondria Different-Phenotype Cells (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Mitotic Cells (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 67.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Pyknosed Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 233.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 256.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 274.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 293.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 322.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 351.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Total Cells | 594.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Control DMSO Tubulin Phenotype Different Cells (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 38.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 40.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Fragmented Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Hoechst High Intensity Objects (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Membrane Permeable-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 41.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitochondria Different-Phenotype (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 51.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 54.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 61.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Mitotic Cells (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 23.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 27.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 43.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 45.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 57.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 60.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 69.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Pyknosed Nuclei (%) | 76.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 18.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 22.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 25.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 39.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Population Tubulin-Different-Phenotype (%) | 44.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 158.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 174.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 175.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 212.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 214.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 229.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 230.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 231.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 250.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 271.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 294.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 327.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 374.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 546.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | HEK-293T | Total Cell Count | 620.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | Kappa opioid receptor | EC50 | 80.0 | nM | 10.1016/j.bmcl.2019.07.033 |
| Homo sapiens | Kappa opioid receptor | EC50 | 80.0 | nM | 10.1021/acs.jmedchem.0c00530 |
| Homo sapiens | Kappa opioid receptor | EC50 | 80.0 | nM | 10.1021/acs.jmedchem.7b01788 |
| Homo sapiens | Kappa opioid receptor | Ki | 1000.0 | nM | 10.1021/jm020125+ |
| Homo sapiens | Lipoxin A4 receptor | %Inhib (Mean) | -2.24 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Lipoxin A4 receptor | %Max (Mean) | -2.95 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | MAP kinase ERK2 | Delta TM | 0.3911 | C | None |
| Homo sapiens | Menin/Histone-lysine N-methyltransferase MLL | Potency | 3548.1 | nM | None |
| Homo sapiens | Mu opioid receptor | EC50 | 1.3 | nM | 10.1016/j.bmcl.2019.07.033 |
| Homo sapiens | Mu opioid receptor | EC50 | 1.3 | nM | 10.1021/acs.jmedchem.0c00530 |
| Homo sapiens | Mu opioid receptor | EC50 | 177.83 | nM | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Mu opioid receptor | EC50 | 794.33 | nM | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Mu opioid receptor | EC50 | 1274.0 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Mu opioid receptor | EC50 | 1288.25 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Mu opioid receptor | Emax | 100.0 | % | 10.1039/D1MD00025J |
| Homo sapiens | Mu opioid receptor | IC50 | 9500.0 | nM | 10.1016/s0960-894x(03)00082-9 |
| Homo sapiens | Mu opioid receptor | Ki | 2.042 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Mu opioid receptor | Ki | 2.07 | nM | 10.1039/D1MD00025J |
| Homo sapiens | Mu opioid receptor | Ki | 9.43 | nM | 10.1016/s0960-894x(00)00660-0 |
| Homo sapiens | Mu opioid receptor | Ki | 55.0 | nM | 10.1021/jm020125+ |
| Homo sapiens | Mu opioid receptor | Ki | 4800.0 | nM | 10.1016/s0960-894x(03)00082-9 |
| Homo sapiens | Mu opioid receptor | Ratio | 1.0 | None | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Mu opioid receptor | Selectivity ratio | 0.0 | None | 10.1021/acs.jmedchem.9b02057 |
| Homo sapiens | Opioid receptors; mu & delta | Ratio | 0.268 | None | 10.1021/jm00123a035 |
| Homo sapiens | Opioid receptors; mu & delta | Ratio | 3.73 | None | 10.1016/s0960-894x(00)00660-0 |
| Homo sapiens | Opioid receptors; mu/kappa/delta | Ki ratio | nan | None | 10.1021/jm020125+ |
| Homo sapiens | Peregrin | Delta TM | 0.02717 | C | None |
| Homo sapiens | Plasma | T1/2 | 13.5 | hr | 10.1016/j.bmc.2009.04.014 |
| Homo sapiens | Proenkephalin B | Kd | 7.1 | nM | 10.1016/s0960-894x(97)10198-6 |
| Homo sapiens | Serine/threonine-protein kinase Aurora-A | Delta TM | 0.07973 | C | None |
| Homo sapiens | Solute carrier organic anion transporter family member 1A2 | Activity | nan | None | None |
| Homo sapiens | Solute carrier organic anion transporter family member 1B1 | Activity | 26.8 | % | 10.1211/0022357021440 |
| Homo sapiens | Solute carrier organic anion transporter family member 1B1 | Inhibition | 84.58 | % | 10.1124/mol.112.084152 |
| Homo sapiens | Solute carrier organic anion transporter family member 1B3 | Inhibition | 87.68 | % | 10.1124/mol.112.084152 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Inhib (Mean) | 12.7 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Sphingosine 1-phosphate receptor Edg-1 | %Max (Mean) | -1.953 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Thyroid hormone receptor beta-1 | Potency | 63095.7 | nM | None |
| Homo sapiens | Transcription intermediary factor 1-alpha | Delta TM | -0.9401 | C | None |
| Homo sapiens | Type-1 angiotensin II receptor | %Inhib (Mean) | -9.202 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Type-1 angiotensin II receptor | %Max (Mean) | -1.695 | % | 10.6019/CHEMBL5209801 |
| Homo sapiens | Tyrosine-protein kinase ABL | Delta TM | -0.00477 | C | None |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 35.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 37.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 43.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Apoptotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Fragmented Nuclei % | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Growth Rate | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Healthy Nuclei (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Membrane Permeable-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitochondria Different-Phenotype Cells (%) | 26.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 47.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 49.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 56.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 62.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 64.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 68.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Mitotic Cells (%) | 73.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Pyknosed Nuclei (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 70.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 102.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 152.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 153.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 165.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 212.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Total Cells | 330.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Control DMSO Tubulin Phenotype Different Cells (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Growth Rate | 0.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Growth Rate | 1.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 28.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 33.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 36.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 46.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 48.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Apoptotic (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Fragmented Nuclei (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 65.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 74.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 77.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 78.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 81.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 82.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 84.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 85.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 86.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Healthy Nuclei (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Hoechst High Intensity Objects (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 0.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 1.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 2.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 4.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Membrane Permeable-Phenotype (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 12.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 19.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 29.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitochondria Different-Phenotype (%) | 32.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 50.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 52.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 53.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 63.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 66.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 71.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 72.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 80.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 83.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Mitotic Cells (%) | 100.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 87.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 88.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 89.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 90.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 92.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 93.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 94.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 95.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 96.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 97.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Normal (%) | 98.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 3.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 6.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 7.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 10.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 17.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Pyknosed Nuclei (%) | 20.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 5.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 8.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 9.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 11.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 13.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 14.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 15.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 16.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 21.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 31.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Population Tubulin-Different-Phenotype (%) | 34.0 | % | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 55.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 62.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 68.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 70.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 80.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 86.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 131.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 136.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 148.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 174.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 211.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 216.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 218.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 229.0 | None | 10.6019/CHEMBL4689842 |
| Homo sapiens | U2OS | Total Cell Count | 251.0 | None | 10.6019/CHEMBL4689842 |
| Mus musculus | Delta opioid receptor | EC50 | 74.0 | nM | 10.1021/acs.jmedchem.0c00530 |
| Mus musculus | Delta opioid receptor | IC50 | 1.07 | nM | 10.1039/D1MD00025J |
| Mus musculus | Delta opioid receptor | IC50 | 1.072 | nM | 10.1039/D1MD00025J |
| Mus musculus | Delta opioid receptor | IC50 | 1.259 | nM | 10.1021/acs.jnatprod.0c01036 |
| Mus musculus | Delta opioid receptor | IC50 | 1.4 | nM | 10.1021/acs.jnatprod.0c01036 |
| Mus musculus | Delta opioid receptor | IC50 | 11.4 | nM | 10.1021/jm00099a025 |
| Mus musculus | Delta opioid receptor | IC50 | 11.4 | nM | 10.1021/jm00354a008 |
| Mus musculus | Delta opioid receptor | IC50 | 11.4 | nM | 10.1021/jm4008592 |
| Mus musculus | Delta opioid receptor | IC50 | 11.4 | nM | 10.1021/jm9019068 |
| Mus musculus | Delta opioid receptor | IC50 | 22.2 | nM | 10.1016/s0960-894x(00)00665-x |
| Mus musculus | Delta opioid receptor | Ke | 5.86 | nM | 10.1021/jm00354a008 |
| Mus musculus | Delta opioid receptor | Ki | 6.3 | nM | 10.1021/acs.jmedchem.0c00530 |
| Mus musculus | Delta opioid receptor | Ki | 6.9 | nM | 10.1021/acs.jmedchem.0c00530 |
| Mus musculus | Delta opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00034a011 |
| Mus musculus | Delta opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00099a025 |
| Mus musculus | Mu opioid receptor | IC50 | 9.4 | nM | 10.1021/jm00365a017 |
| Mus musculus | Mu opioid receptor | IC50 | 19.95 | nM | 10.1039/D1MD00025J |
| Mus musculus | Mu opioid receptor | IC50 | 20.0 | nM | 10.1039/D1MD00025J |
| Mus musculus | Mu opioid receptor | Relative Potency | 1.0 | None | 10.1021/jm00365a017 |
| Mus musculus | Mus musculus | IC50 | 8.6 | nM | 10.1021/jm00394a010 |
| Mus musculus | Mus musculus | IC50 | 11.4 | nM | 10.1016/s0960-894x(00)00660-0 |
| Mus musculus | Mus musculus | IC50 | 11.4 | nM | 10.1021/jm00034a011 |
| Mus musculus | Mus musculus | IC50 | 11.4 | nM | 10.1021/jm00100a026 |
| Mus musculus | Mus musculus | IC50 | 11.4 | nM | 10.1021/jm00122a005 |
| Mus musculus | Mus musculus | IC50 | 11.4 | nM | 10.1021/jm00123a035 |
| Mus musculus | Mus musculus | IC50 | 11.4 | nM | 10.1021/jm00150a005 |
| Mus musculus | Mus musculus | Ke | 21.4 | nM | 10.1021/jm00123a035 |
| Mus musculus | Mus musculus | Relative potency | 1.0 | None | 10.1021/jm00100a026 |
| Mus musculus | Mus musculus | Relative potency | 1.0 | None | 10.1021/jm00123a035 |
| Mus musculus | Opioid receptor | IC50 | 8.4 | nM | 10.1021/jm00368a003 |
| Mus musculus | Opioid receptor | IC50 | 75.0 | nM | 10.1021/jm00368a003 |
| Rattus norvegicus | Delta opioid receptor | IC50 | 17.7 | nM | 10.1021/jm00354a008 |
| Rattus norvegicus | Delta opioid receptor | Ki | 1.43 | nM | 10.1016/s0960-894x(00)00665-x |
| Rattus norvegicus | Delta opioid receptor | Ki | 1.5 | nM | 10.1021/jm00122a005 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm00034a011 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm00073a020 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm00099a025 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm00122a005 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm00123a035 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm00150a005 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm9019068 |
| Rattus norvegicus | Delta opioid receptor | Ki | 2.53 | nM | 10.1021/jm980724+ |
| Rattus norvegicus | Delta opioid receptor | Ki | 6.3 | nM | 10.1016/j.bmcl.2013.08.020 |
| Rattus norvegicus | Delta opioid receptor | Ki | 8.05 | nM | 10.1021/jm00354a008 |
| Rattus norvegicus | Delta opioid receptor | Ki | 9.43 | nM | 10.1021/jm990461z |
| Rattus norvegicus | Delta opioid receptor | Potency | 1.0 | None | 10.1021/jm00073a020 |
| Rattus norvegicus | Delta opioid receptor | Potency ratio | 1.0 | None | 10.1021/jm00150a005 |
| Rattus norvegicus | Delta opioid receptor | Ratio | 0.291 | None | 10.1021/jm00354a008 |
| Rattus norvegicus | Delta opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00034a011 |
| Rattus norvegicus | Delta opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00099a025 |
| Rattus norvegicus | Delta opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00123a035 |
| Rattus norvegicus | Delta opioid receptor | Relative potency | 1.0 | None | 10.1021/jm980724+ |
| Rattus norvegicus | Kappa opioid receptor | Ki | 10000.0 | nM | 10.1016/s0960-894x(02)00678-9 |
| Rattus norvegicus | Mu opioid receptor | IC50 | 49.8 | nM | 10.1021/jm00354a008 |
| Rattus norvegicus | Mu opioid receptor | Ki | 2.42 | nM | 10.1016/s0960-894x(00)00665-x |
| Rattus norvegicus | Mu opioid receptor | Ki | 2.53 | nM | 10.1021/jm990461z |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm00034a011 |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm00073a020 |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm00099a025 |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm00122a005 |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm00123a035 |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm00150a005 |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm9019068 |
| Rattus norvegicus | Mu opioid receptor | Ki | 9.43 | nM | 10.1021/jm980724+ |
| Rattus norvegicus | Mu opioid receptor | Ki | 24.0 | nM | 10.1016/s0960-894x(02)00678-9 |
| Rattus norvegicus | Mu opioid receptor | Ki | 27.7 | nM | 10.1021/jm00354a008 |
| Rattus norvegicus | Mu opioid receptor | Potency | 1.0 | None | 10.1021/jm00073a020 |
| Rattus norvegicus | Mu opioid receptor | Potency ratio | 1.0 | None | 10.1021/jm00150a005 |
| Rattus norvegicus | Mu opioid receptor | Ratio | 3.73 | None | 10.1021/jm980724+ |
| Rattus norvegicus | Mu opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00034a011 |
| Rattus norvegicus | Mu opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00099a025 |
| Rattus norvegicus | Mu opioid receptor | Relative potency | 1.0 | None | 10.1021/jm00123a035 |
| Rattus norvegicus | Mu opioid receptor | Relative potency | 1.0 | None | 10.1021/jm980724+ |
| Rattus norvegicus | Mu opioid receptor | SR | 1.69 | None | 10.1016/s0960-894x(00)00665-x |
| Rattus norvegicus | Opioid receptor | Activity | 38.0 | % | 10.1021/jm00177a016 |
| Rattus norvegicus | Opioid receptor | RBA | 38.0 | % | 10.1021/jm00209a004 |
| Rattus norvegicus | Opioid receptors; mu & delta | Ratio | 0.268 | None | 10.1021/jm00034a011 |
| Rattus norvegicus | Opioid receptors; mu & delta | Ratio | 3.73 | None | 10.1021/jm00099a025 |
| Rattus norvegicus | Opioid receptors; mu & delta | Selectivity | 0.268 | None | 10.1021/jm00150a005 |
| Rattus norvegicus | Rattus norvegicus | Activity | 37.7 | None | 10.1016/s0960-894x(02)00847-8 |
| Rattus norvegicus | Rattus norvegicus | Ca2+ | 2.18 | mM l-1 | 10.1016/s0960-894x(02)00847-8 |
| Rattus norvegicus | Rattus norvegicus | Ca2+ | 43.75 | % | 10.1016/s0960-894x(02)00847-8 |
| Rattus norvegicus | Rattus norvegicus | ED50 | 0.1 | mg.kg-1 | 10.1021/jm00100a026 |
| Rattus norvegicus | Rattus norvegicus | IC50 | 11.0 | nM | 10.1021/jm00365a017 |
| Rattus norvegicus | Rattus norvegicus | Phosphor | 22.27 | % | 10.1016/s0960-894x(02)00847-8 |
| Rattus norvegicus | Rattus norvegicus | Relative Potency | 1.0 | None | 10.1021/jm00365a017 |
| Rattus norvegicus | Rattus norvegicus | Weight | 21.74 | mg | 10.1016/s0960-894x(02)00847-8 |
| Rattus norvegicus | Rattus norvegicus | Weight | 39.49 | mg | 10.1016/s0960-894x(02)00847-8 |
| Rattus norvegicus | Rattus norvegicus | WEIGHT | 33.29 | g | 10.1016/s0960-894x(02)00847-8 |
| Severe acute respiratory syndrome coronavirus 2 | Replicase polyprotein 1ab | Inhibition | 8.19 | % | 10.6019/CHEMBL4495564 |
| Severe acute respiratory syndrome coronavirus 2 | SARS-CoV-2 | Inhibition | 0.0 | % | 10.6019/CHEMBL4495565 |
| None | ADMET | Stability | 15.0 | % | 10.1021/acs.jmedchem.6b01200 |
| None | ADMET | T1/2 | 0.07667 | hr | 10.1021/acs.jmedchem.0c00530 |
| None | ADMET | T1/2 | 0.08333 | hr | 10.1016/j.bmcl.2019.07.033 |
| None | ADMET | T1/2 | 0.08333 | hr | 10.1021/acs.jmedchem.0c00530 |
| None | ADMET | T1/2 | 0.2 | hr | 10.1021/acs.jmedchem.0c00530 |
| None | Monoclonal antibody (mAb) 3E7 | Activity | nan | None | 10.1016/S0960-894X(01)80224-9 |
| None | Monoclonal antibody (mAb) 3E7 | IC50 | 17.5 | nM | 10.1016/S0960-894X(01)80224-9 |
| None | NON-PROTEIN TARGET | Ratio | 0.046 | None | 10.1021/jm00354a008 |
| None | NON-PROTEIN TARGET | Ratio | 0.0463 | None | 10.1021/jm00123a035 |
| None | No relevant target | LogD | -0.95 | None | 10.1021/acs.jmedchem.7b01788 |
| None | Unchecked | IC50 | 100.0 | nM | 10.1016/S0960-894X(96)00565-3 |
| None | Unchecked | KD' | 1.19 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 1.25 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 5.81 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 6.85 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 7.04 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 7.52 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 7.87 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 8.3 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 9.24 | M | 10.1021/jm00368a002 |
| None | Unchecked | KD' | 9.8 | M | 10.1021/jm00368a002 |
| None | Unchecked | Ki | 64.73 | nM | 10.1021/acsmedchemlett.5b00126 |
| None | Unchecked | Ki | 175.2 | nM | 10.1021/acsmedchemlett.5b00126 |
| None | Unchecked | Ki | 1317.0 | nM | 10.1021/acsmedchemlett.5b00126 |
| None | Unchecked | Ratio | 0.046 | None | 10.1021/jm00100a026 |
| None | Unchecked | Ratio | 0.0463 | None | 10.1021/jm00034a011 |
| None | Unchecked | Ratio | 0.0463 | None | 10.1021/jm00150a005 |
| None | Unchecked | Ratio | 4.64 | None | 10.1016/s0960-894x(00)00665-x |
| None | Unchecked | Ratio | 21.6 | None | 10.1021/jm00099a025 |
| None | Unchecked | Ratio | 21.6 | None | 10.1021/jm00122a005 |
| None | Unchecked | Ratio EC50 | 16.0 | None | 10.1021/acs.jmedchem.0c00530 |
| None | Unchecked | Ratio EC50 | 1000.0 | None | 10.1021/acs.jmedchem.0c00530 |
| None | Unchecked | Ratio Ki | 0.3 | None | 10.1021/jm9019068 |
| None | Unchecked | Ratio Ki | 1.8 | None | 10.1039/D1MD00025J |
| None | Unchecked | Ratio Ki | 485.0 | None | 10.1021/jm9019068 |
| None | Unchecked | Relative potency | 1.0 | None | 10.1021/jm00150a005 |
| None | Unchecked | Selectivity ratio | 1.0 | None | 10.1016/j.bmcl.2013.08.020 |