2'-O-demethylherbicidin F
AlkaPlorer ID: AK038274
Synonym: None
IUPAC Name: methyl (1R,3R,4R,5R,7R,9R,11S,12S,13S)-5-(6-aminopurin-9-yl)-1,4,12-trihydroxy-13-[(E)-2-methylbut-2-enoyl]oxy-2,6,10-trioxatricyclo[7.4.0.03,7]tridecane-11-carboxylate
Structure
SMILES: C/C=C(\C)C(=O)O[C@H]1[C@H](O)[C@@H](C(=O)OC)O[C@@H]2C[C@H]3O[C@@H](N4C=NC5=C(N)N=CN=C54)[C@H](O)[C@H]3O[C@]21O
InChI: InChI=1S/C22H27N5O10/c1-4-8(2)20(30)36-16-12(28)15(21(31)33-3)35-10-5-9-14(37-22(10,16)32)13(29)19(34-9)27-7-26-11-17(23)24-6-25-18(11)27/h4,6-7,9-10,12-16,19,28-29,32H,5H2,1-3H3,(H2,23,24,25)/b8-4+/t9-,10-,12-,13-,14+,15+,16+,19-,22-/m1/s1
InChIKey: LUHFPLRYWUPHKS-ORBSYVJISA-N
Reference
Herbicidin Congeners, Undecose Nucleosides from an Organic Extract of <i>Streptomyces</i> sp. L-9-10
PubChem CID: 76317500
LOTUS: LTS0154640
NPASS: NPC276373
{NPAtlas: NPA004772
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Streptomyces sp. CB01388 | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
| Streptomyces sp. L-9-10 | Streptomyces | Streptomycetaceae | Kitasatosporales | Actinomycetes | Actinomycetota | None | Bacteria |
Properties Information
Molecule Weight: 521.4830000000002
TPSA？: 210.6
MolLogP？: -1.6763999999999957
Number of H-Donors: 4
Number of H-Acceptors: 15
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Cryptosporidium parvum | Cryptosporidium parvum | EC50 | 2700.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Cryptosporidium parvum | Cryptosporidium parvum | EC50 | 2800.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | HCT-8 | EC50 | 25000.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | HEK293 | IC50 | 2200.0 | nM | 10.1021/np4006635 |
| Homo sapiens | HEK-293T | CC50 | 40000.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | HepG2 | CC50 | 40000.0 | nM | 10.1021/acs.jnatprod.7b00850 |
| Homo sapiens | MCF7 | Activity | nan | None | 10.1021/np4006635 |
| Homo sapiens | Nitric oxide synthase, inducible | Inhibition | nan | % | 10.1021/np4006635 |
| Streptomyces | Streptomyces | Activity | nan | None | 10.1021/np4006635 |
| None | Radical scavenging activity | Activity | nan | None | 10.1021/np4006635 |
| None | Unchecked | IC50 | 4900.0 | nM | 10.1021/np4006635 |
| None | Unchecked | Inhibition | 42.3 | % | 10.1021/np4006635 |
| None | Unchecked | Inhibition | 92.4 | % | 10.1021/np4006635 |