Meridine
AlkaPlorer ID: AK040247
Synonym: None
IUPAC Name: 6,10,20-triazapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),4,9,11,13(21),14,16,18-nonaene-3,8-dione
Structure
SMILES: O=C1C2=C(C(O)=CC=N2)C2=C3C1=NC=CC3=C1C=CC=CC1=N2
InChI: InChI=1S/C18H9N3O2/c22-12-6-8-20-17-14(12)15-13-10(5-7-19-16(13)18(17)23)9-3-1-2-4-11(9)21-15/h1-8H,(H,20,22)
InChIKey: QSJNAFJALFWFMT-UHFFFAOYSA-N
Reference
PubChem CID: 72473
CAS: 129722-90-3
LOTUS: LTS0168265
SuperNatural Ⅲ: SN0313932
COCONUT: CNP0108975
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 299.289
TPSA?: 75.97
MolLogP?: 3.095000000000001
Number of H-Donors: 1
Number of H-Acceptors: 5
RingCount: 5
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bacillus subtilis | Bacillus subtilis | MIC | 3.1 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | IC50 | 1.0 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | IC50 | 50.0 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | IC50 | 100.0 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MFC | 0.2 | ug ml-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MFC | 3.1 | ug ml-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MIC | 0.2 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MIC | 0.31 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MIC | 0.62 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MIC | 1.2 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MIC | 2.5 | ug.mL-1 | 10.1021/np50089a016 |
| Candida albicans | Candida albicans | MIC | 3.1 | ug.mL-1 | 10.1021/np50089a016 |
| Cryptococcus neoformans | Cryptococcus neoformans | MFC | 6.2 | ug ml-1 | 10.1021/np50089a016 |
| Cryptococcus neoformans | Cryptococcus neoformans | MIC | 0.8 | ug.mL-1 | 10.1021/np50089a016 |
| Epidermophyton floccosum | Epidermophyton floccosum | MIC | 1.6 | ug.mL-1 | 10.1021/np50089a016 |
| Escherichia coli | Escherichia coli | Activity | nan | None | 10.1021/np50089a016 |
| Homo sapiens | A-427 | IC50 | 200.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | A549 | IC50 | 4.5 | ug.mL-1 | 10.1021/np50096a015 |
| Homo sapiens | A549 | IC50 | 80.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | HCT-15 | IC50 | 200.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | HT-29 | IC50 | 0.2 | ug.mL-1 | 10.1021/np50096a015 |
| Homo sapiens | J82 | IC50 | 8200.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | LoVo | IC50 | 70.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | MCF7 | IC50 | 90.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | PC-3 | IC50 | 500.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | T47D | IC50 | 70.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | Telomerase reverse transcriptase | IC50 | 11.0 | ug.mL-1 | 10.1039/C0MD00241K |
| Homo sapiens | Telomerase reverse transcriptase | IC50 | 11000.0 | nM | 10.1016/j.ejmech.2013.07.022 |
| Homo sapiens | U373 MG | IC50 | 100.0 | nM | 10.1021/jm0108496 |
| Homo sapiens | U-87 MG | IC50 | 100.0 | nM | 10.1021/jm0108496 |
| Mus musculus | P388 | IC50 | 2.0 | ug.mL-1 | 10.1021/np50096a015 |
| Nannizzia gypsea | Nannizzia gypsea | MIC | 25.0 | ug.mL-1 | 10.1021/np50089a016 |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | nan | None | 10.1021/np50089a016 |
| Scopulariopsis brevicaulis | Scopulariopsis brevicaulis | MIC | 25.0 | ug.mL-1 | 10.1021/np50089a016 |
| Sporothrix schenckii | Sporothrix schenckii | MIC | 25.0 | ug.mL-1 | 10.1021/np50089a016 |
| Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | 6.2 | ug.mL-1 | 10.1021/np50089a016 |
| Trichosporon beigelii | Trichosporon beigelii | MIC | 25.0 | ug.mL-1 | 10.1021/np50089a016 |
| None | NON-PROTEIN TARGET | IC50 | 8.8 | ug.mL-1 | 10.1021/np50096a015 |
| None | Unchecked | Activity | nan | None | 10.1021/np50096a015 |
| None | Unchecked | IC50 | 50.0 | nM | 10.1021/jm0108496 |
| None | Unchecked | IC50 | 2000.0 | nM | 10.1021/jm0108496 |
