7-bromo-4-oxo-1,4-dihydroquinoline-2-carboxylic acid
AlkaPlorer ID: AK043266
Synonym: None
IUPAC Name: 7-bromo-4-oxo-1H-quinoline-2-carboxylic acid
Structure
SMILES: O=C(O)C1=CC(=O)C2=CC=C(Br)C=C2N1
InChI: InChI=1S/C10H6BrNO3/c11-5-1-2-6-7(3-5)12-8(10(14)15)4-9(6)13/h1-4H,(H,12,13)(H,14,15)
InChIKey: DGJNOQNOMLMGQD-UHFFFAOYSA-N
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|
Properties Information
Molecule Weight: 268.066
TPSA？: 70.16
MolLogP？: 1.9888
Number of H-Donors: 2
Number of H-Acceptors: 2
RingCount: 2
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Candida albicans | Candida albicans | Activity | nan | None | 10.1021/np100329w |
| Enterococcus faecalis | Enterococcus faecalis | Activity | nan | None | 10.1021/np100329w |
| Escherichia coli | Escherichia coli | Activity | nan | None | 10.1021/np100329w |
| Homo sapiens | MCF7 | Inhibition | 39.0 | % | 10.1021/np100329w |
| Homo sapiens | MM96L | Inhibition | 62.0 | % | 10.1021/np100329w |
| Homo sapiens | NFF | Inhibition | 57.0 | % | 10.1021/np100329w |
| Pseudomonas aeruginosa | Pseudomonas aeruginosa | Activity | nan | None | 10.1021/np100329w |
| Rattus norvegicus | Glutamate NMDA receptor | IC50 | 850.0 | nM | 10.1021/jm00108a002 |
| Rattus norvegicus | Glutamate NMDA receptor | Kb | 8000.0 | nM | 10.1021/jm00108a002 |
| Rattus norvegicus | Glutamate NMDA receptor | -Log 1/Kb | 5.097 | None | 10.1021/jm00108a002 |
| Staphylococcus aureus | Staphylococcus aureus | Activity | nan | None | 10.1021/np100329w |