7-Deoxyhomomannojirimycin
AlkaPlorer ID: AK043934
Synonym: '', 'beta-L-Homofuconojirimycin', '(-)-7-Deoxyhomomannojirimycin', '(+)-alpha-7-Deoxyhomonojirimycin', 'alpha-7-Deoxyhomonojirimycin'
IUPAC Name: (2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-methylpiperidine-3,4,5-triol
Structure
SMILES: C[C@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
InChI: InChI=1S/C7H15NO4/c1-3-5(10)7(12)6(11)4(2-9)8-3/h3-12H,2H2,1H3/t3-,4-,5+,6-,7-/m1/s1
InChIKey: ZEWFPWKROPWRKE-XUUWZHRGSA-N
Reference
α-Glucosidase-inhibitory iminosugars from the leaves of Suregada glomerulata
PubChem CID: 10921056
LOTUS: LTS0045051
SuperNatural Ⅲ: SN0468521-06
NPASS: NPC286851
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Suregada glomerulata | Suregada | Euphorbiaceae | Malpighiales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
| None | Scilla | Hyacinthaceae | Asparagales | Magnoliopsida | Streptophyta | Viridiplantae | Eukaryota |
Properties Information
Molecule Weight: 177.20000000000002
TPSA？: 92.95
MolLogP？: -2.578299999999999
Number of H-Donors: 5
Number of H-Acceptors: 5
RingCount: 1
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Bos taurus | Alpha-L-fucosidase 1 | Inhibition | 50.0 | % | 10.1021/np020296h |
| Bos taurus | Beta-galactosidase | IC50 | 260000.0 | nM | 10.1021/np020296h |
| Caldicellulosiruptor saccharolyticus | Beta-glucosidase A | Inhibition | 50.0 | % | 10.1021/np020296h |
| Rattus norvegicus | Acidic alpha-glucosidase | IC50 | 18000.0 | nM | 10.1021/np020296h |
| Rattus norvegicus | Acidic alpha-glucosidase | IC50 | 19000.0 | nM | 10.1021/np020296h |
| Rattus norvegicus | Beta-mannosidase | Inhibition | 50.0 | % | 10.1021/np020296h |
| Saccharomyces cerevisiae S288c | Oligo-1,6-glucosidase | Inhibition | 50.0 | % | 10.1021/np020296h |
| None | Unchecked | IC50 | 8000.0 | nM | 10.1021/np020296h |
| None | Unchecked | IC50 | 22130.0 | nM | 10.1016/j.bmc.2013.07.048 |
| None | Unchecked | IC50 | 94000.0 | nM | 10.1021/np020296h |