2-hydroxy-phenazine
AlkaPlorer ID: AK044517
Synonym: None
IUPAC Name: phenazin-2-ol
Structure
SMILES: OC1=CC=C2N=C3C=CC=CC3=NC2=C1
InChI: InChI=1S/C12H8N2O/c15-8-5-6-11-12(7-8)14-10-4-2-1-3-9(10)13-11/h1-7,15H
InChIKey: RETSEGNZNUBJRB-UHFFFAOYSA-N
Reference
The Isolation and Characterization of 2-Hydroxyphenazine from Pseudomonas aureofaciens<sup>*</sup>
PubChem CID: 135441800
CAS: 4190-95-8
LOTUS: LTS0208270
SuperNatural Ⅲ: SN0323401
COCONUT: CNP0286593
Source
| Species | Genus | Family | Order | Class | Phylum | Kingdom | Domain |
|---|---|---|---|---|---|---|---|
| Pseudomonas chlororaphis | Pseudomonas | Pseudomonadaceae | Pseudomonadales | Gammaproteobacteria | Pseudomonadota | None | Bacteria |
Properties Information
Molecule Weight: 196.209
TPSA?: 46.010000000000005
MolLogP?: 2.4886
Number of H-Donors: 1
Number of H-Acceptors: 3
RingCount: 3
Activities Information
| Organism | Target Name | Standard Type | Standard Value | Standard Units | doi |
|---|---|---|---|---|---|
| Arthrobacter crystallopoietes | Arthrobacter crystallopoietes | MIC | nan | None | 10.1021/np3005166 |
| Bacillus cereus | Bacillus cereus | MIC | nan | None | 10.1021/np3005166 |
| Bacillus subtilis | Bacillus subtilis | Activity | nan | None | 10.1021/acs.jnatprod.9b00315 |
| Bacillus subtilis | Bacillus subtilis | IC50 | 75000.0 | nM | 10.1021/np2009626 |
| Enterococcus hirae | Enterococcus hirae | Activity | nan | None | 10.1021/acs.jnatprod.9b00315 |
| Homo sapiens | Acetylcholinesterase | IC50 | 50000.0 | nM | 10.1021/np2009626 |
| Homo sapiens | HCT-116 | IC50 | nan | None | 10.1021/np3005166 |
| Homo sapiens | LNCaP | IZ | nan | None | 10.1021/np3005166 |
| Homo sapiens | MCF7 | IZ | nan | None | 10.1021/np3005166 |
| Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC90 | nan | None | 10.1021/np3005166 |
| Staphylococcus aureus | Staphylococcus aureus | Activity | nan | None | 10.1021/acs.jnatprod.9b00315 |
| Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | 33.4 | ug.mL-1 | 10.1021/acs.jnatprod.9b00315 |
| Streptococcus mutans | Streptococcus mutans | Activity | nan | None | 10.1021/acs.jnatprod.9b00315 |
| None | ADMET | IC50 | 50000.0 | nM | 10.1021/np2009626 |
| None | Molecular identity unknown | IZ | nan | None | 10.1021/np3005166 |
| None | NON-PROTEIN TARGET | IZ | nan | None | 10.1021/np3005166 |
